|
Name |
Dihydroaltenuene A
|
| Molecular Formula | C15H18O6 | |
| IUPAC Name* |
(2R,3S,4aS,10bR)-2,3,7-trihydroxy-9-methoxy-4a-methyl-2,3,4,10b-tetrahydro-1H-benzo[c]chromen-6-one
|
|
| SMILES |
C[C@]12C[C@@H]([C@@H](C[C@@H]1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O)O
|
|
| InChI |
InChI=1S/C15H18O6/c1-15-6-12(18)10(16)5-9(15)8-3-7(20-2)4-11(17)13(8)14(19)21-15/h3-4,9-10,12,16-18H,5-6H2,1-2H3/t9-,10-,12+,15+/m1/s1
|
|
| InChIKey |
HDWRQDAKGPKDFF-FCIGDQIPSA-N
|
|
| Synonyms |
Dihydroaltenuene A; Dihydroaltenuenes A; CHEMBL482025
|
|
| CAS | NA | |
| PubChem CID | 11493074 | |
| ChEMBL ID | CHEMBL482025 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 294.3 | ALogp: | 1.3 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 96.2 | Aromatic Rings: | 3 |
| Heavy Atoms: | 21 | QED Weighted: | 0.677 |
| Caco-2 Permeability: | -5.062 | MDCK Permeability: | 0.00001320 |
| Pgp-inhibitor: | 0.005 | Pgp-substrate: | 0.429 |
| Human Intestinal Absorption (HIA): | 0.031 | 20% Bioavailability (F20%): | 0.011 |
| 30% Bioavailability (F30%): | 0.34 |
| Blood-Brain-Barrier Penetration (BBB): | 0.862 | Plasma Protein Binding (PPB): | 77.11% |
| Volume Distribution (VD): | 1.03 | Fu: | 22.03% |
| CYP1A2-inhibitor: | 0.337 | CYP1A2-substrate: | 0.657 |
| CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.699 |
| CYP2C9-inhibitor: | 0.041 | CYP2C9-substrate: | 0.781 |
| CYP2D6-inhibitor: | 0.038 | CYP2D6-substrate: | 0.281 |
| CYP3A4-inhibitor: | 0.521 | CYP3A4-substrate: | 0.207 |
| Clearance (CL): | 11.675 | Half-life (T1/2): | 0.527 |
| hERG Blockers: | 0.035 | Human Hepatotoxicity (H-HT): | 0.197 |
| Drug-inuced Liver Injury (DILI): | 0.365 | AMES Toxicity: | 0.067 |
| Rat Oral Acute Toxicity: | 0.142 | Maximum Recommended Daily Dose: | 0.789 |
| Skin Sensitization: | 0.356 | Carcinogencity: | 0.047 |
| Eye Corrosion: | 0.009 | Eye Irritation: | 0.263 |
| Respiratory Toxicity: | 0.736 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002607 | ![]() |
1.000 | D07MGA | ![]() |
0.269 | ||
| ENC002695 | ![]() |
1.000 | D0Z1FX | ![]() |
0.247 | ||
| ENC004130 | ![]() |
0.563 | D0J4IX | ![]() |
0.227 | ||
| ENC004851 | ![]() |
0.541 | D0L7AS | ![]() |
0.224 | ||
| ENC005177 | ![]() |
0.541 | D0I9HF | ![]() |
0.224 | ||
| ENC002647 | ![]() |
0.541 | D0P1FO | ![]() |
0.222 | ||
| ENC006131 | ![]() |
0.541 | D01XWG | ![]() |
0.221 | ||
| ENC006132 | ![]() |
0.541 | D0J1ML | ![]() |
0.220 | ||
| ENC000620 | ![]() |
0.541 | D0C9XJ | ![]() |
0.216 | ||
| ENC000971 | ![]() |
0.541 | D07VLY | ![]() |
0.216 | ||