|
Name |
tardioxopiperazine B
|
| Molecular Formula | C24H31N3O2 | |
| IUPAC Name* |
(3S,6S)-3-methyl-6-[[2-(2-methylbut-3-en-2-yl)-7-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]piperazine-2,5-dione
|
|
| SMILES |
C[C@H]1C(=O)N[C@H](C(=O)N1)CC2=C(NC3=C(C=CC=C23)CC=C(C)C)C(C)(C)C=C
|
|
| InChI |
InChI=1S/C24H31N3O2/c1-7-24(5,6)21-18(13-19-23(29)25-15(4)22(28)26-19)17-10-8-9-16(20(17)27-21)12-11-14(2)3/h7-11,15,19,27H,1,12-13H2,2-6H3,(H,25,29)(H,26,28)/t15-,19-/m0/s1
|
|
| InChIKey |
QNQMVKRHUCFRIY-KXBFYZLASA-N
|
|
| Synonyms |
tardioxopiperazine B; CHEMBL249257; CHEBI:193006; cyclo-L-2-tert-DMA-7-DMA-Trp-L-Ala; 2-(1,1-Dimethyl-2-propenyl)-7-isopentenylcyclo(L-Trp-L-Ala-)
|
|
| CAS | NA | |
| PubChem CID | 10810597 | |
| ChEMBL ID | CHEMBL249257 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 393.5 | ALogp: | 5.1 |
| HBD: | 3 | HBA: | 2 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 74.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 29 | QED Weighted: | 0.637 |
| Caco-2 Permeability: | -4.848 | MDCK Permeability: | 0.00001320 |
| Pgp-inhibitor: | 0.981 | Pgp-substrate: | 0.05 |
| Human Intestinal Absorption (HIA): | 0.037 | 20% Bioavailability (F20%): | 0.91 |
| 30% Bioavailability (F30%): | 0.095 |
| Blood-Brain-Barrier Penetration (BBB): | 0.771 | Plasma Protein Binding (PPB): | 93.29% |
| Volume Distribution (VD): | 0.962 | Fu: | 3.47% |
| CYP1A2-inhibitor: | 0.301 | CYP1A2-substrate: | 0.316 |
| CYP2C19-inhibitor: | 0.909 | CYP2C19-substrate: | 0.123 |
| CYP2C9-inhibitor: | 0.719 | CYP2C9-substrate: | 0.557 |
| CYP2D6-inhibitor: | 0.749 | CYP2D6-substrate: | 0.648 |
| CYP3A4-inhibitor: | 0.944 | CYP3A4-substrate: | 0.501 |
| Clearance (CL): | 1.813 | Half-life (T1/2): | 0.164 |
| hERG Blockers: | 0.056 | Human Hepatotoxicity (H-HT): | 0.505 |
| Drug-inuced Liver Injury (DILI): | 0.838 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 0.913 | Maximum Recommended Daily Dose: | 0.267 |
| Skin Sensitization: | 0.113 | Carcinogencity: | 0.078 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.979 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002068 | ![]() |
0.756 | D0N1WU | ![]() |
0.232 | ||
| ENC000859 | ![]() |
0.693 | D0O6KE | ![]() |
0.220 | ||
| ENC003867 | ![]() |
0.673 | D0W7WC | ![]() |
0.217 | ||
| ENC003866 | ![]() |
0.673 | D01AYJ | ![]() |
0.216 | ||
| ENC002460 | ![]() |
0.663 | D0Q0PR | ![]() |
0.215 | ||
| ENC002631 | ![]() |
0.648 | D0B4DC | ![]() |
0.205 | ||
| ENC001987 | ![]() |
0.640 | D0W6DG | ![]() |
0.202 | ||
| ENC002896 | ![]() |
0.596 | D0NG7O | ![]() |
0.198 | ||
| ENC003796 | ![]() |
0.573 | D0H5MB | ![]() |
0.197 | ||
| ENC002630 | ![]() |
0.505 | D0WN0U | ![]() |
0.197 | ||