|
Name |
tardioxopiperazine A
|
| Molecular Formula | C24H31N3O2 | |
| IUPAC Name* |
(3S,6S)-3-methyl-6-[[2-(2-methylbut-3-en-2-yl)-5-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]piperazine-2,5-dione
|
|
| SMILES |
C[C@H]1C(=O)N[C@H](C(=O)N1)CC2=C(NC3=C2C=C(C=C3)CC=C(C)C)C(C)(C)C=C
|
|
| InChI |
InChI=1S/C24H31N3O2/c1-7-24(5,6)21-18(13-20-23(29)25-15(4)22(28)27-20)17-12-16(9-8-14(2)3)10-11-19(17)26-21/h7-8,10-12,15,20,26H,1,9,13H2,2-6H3,(H,25,29)(H,27,28)/t15-,20-/m0/s1
|
|
| InChIKey |
WXGWEFVOPYZZTA-YWZLYKJASA-N
|
|
| Synonyms |
tardioxopiperazine A; CHEMBL400852; CHEBI:193007; cyclo-L-2-tert-DMA-5-DMA-Trp-L-Ala; (3S,6S)-3-methyl-6-[[2-(2-methylbut-3-en-2-yl)-5-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]piperazine-2,5-dione
|
|
| CAS | NA | |
| PubChem CID | 10810596 | |
| ChEMBL ID | CHEMBL400852 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 393.5 | ALogp: | 5.1 |
| HBD: | 3 | HBA: | 2 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 74.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 29 | QED Weighted: | 0.637 |
| Caco-2 Permeability: | -4.83 | MDCK Permeability: | 0.00001300 |
| Pgp-inhibitor: | 0.99 | Pgp-substrate: | 0.038 |
| Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.91 |
| 30% Bioavailability (F30%): | 0.153 |
| Blood-Brain-Barrier Penetration (BBB): | 0.622 | Plasma Protein Binding (PPB): | 94.11% |
| Volume Distribution (VD): | 0.991 | Fu: | 3.37% |
| CYP1A2-inhibitor: | 0.433 | CYP1A2-substrate: | 0.329 |
| CYP2C19-inhibitor: | 0.851 | CYP2C19-substrate: | 0.165 |
| CYP2C9-inhibitor: | 0.616 | CYP2C9-substrate: | 0.739 |
| CYP2D6-inhibitor: | 0.682 | CYP2D6-substrate: | 0.723 |
| CYP3A4-inhibitor: | 0.931 | CYP3A4-substrate: | 0.344 |
| Clearance (CL): | 1.745 | Half-life (T1/2): | 0.161 |
| hERG Blockers: | 0.176 | Human Hepatotoxicity (H-HT): | 0.57 |
| Drug-inuced Liver Injury (DILI): | 0.292 | AMES Toxicity: | 0.015 |
| Rat Oral Acute Toxicity: | 0.886 | Maximum Recommended Daily Dose: | 0.608 |
| Skin Sensitization: | 0.091 | Carcinogencity: | 0.089 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.97 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002069 | ![]() |
0.756 | D0NG7O | ![]() |
0.252 | ||
| ENC000859 | ![]() |
0.676 | D0O6KE | ![]() |
0.220 | ||
| ENC002631 | ![]() |
0.667 | D0Z6UC | ![]() |
0.218 | ||
| ENC002630 | ![]() |
0.663 | D0W7WC | ![]() |
0.217 | ||
| ENC003867 | ![]() |
0.657 | D0JO3U | ![]() |
0.217 | ||
| ENC003866 | ![]() |
0.657 | D0W6DG | ![]() |
0.212 | ||
| ENC006144 | ![]() |
0.612 | D0Q0PR | ![]() |
0.207 | ||
| ENC002896 | ![]() |
0.582 | D0H5MB | ![]() |
0.206 | ||
| ENC003796 | ![]() |
0.518 | D0R0MW | ![]() |
0.205 | ||
| ENC001987 | ![]() |
0.505 | D06XZW | ![]() |
0.204 | ||