![]() |
Name |
Cristatumin B
|
Molecular Formula | C29H39N3O3 | |
IUPAC Name* |
(3S,6S)-3-(hydroxymethyl)-6-[[2-(2-methylbut-3-en-2-yl)-5,7-bis(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]piperazine-2,5-dione
|
|
SMILES |
CC(=CCC1=CC(=C2C(=C1)C(=C(N2)C(C)(C)C=C)C[C@H]3C(=O)N[C@H](C(=O)N3)CO)CC=C(C)C)C
|
|
InChI |
InChI=1S/C29H39N3O3/c1-8-29(6,7)26-22(15-23-27(34)31-24(16-33)28(35)30-23)21-14-19(11-9-17(2)3)13-20(25(21)32-26)12-10-18(4)5/h8-10,13-14,23-24,32-33H,1,11-12,15-16H2,2-7H3,(H,30,35)(H,31,34)/t23-,24-/m0/s1
|
|
InChIKey |
MSZGZJISTUDEGW-ZEQRLZLVSA-N
|
|
Synonyms |
Cristatumin B; CHEMBL2048727
|
|
CAS | NA | |
PubChem CID | 70682035 | |
ChEMBL ID | CHEMBL2048727 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 477.6 | ALogp: | 6.5 |
HBD: | 4 | HBA: | 3 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 94.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 35 | QED Weighted: | 0.393 |
Caco-2 Permeability: | -4.96 | MDCK Permeability: | 0.00000819 |
Pgp-inhibitor: | 0.421 | Pgp-substrate: | 0.26 |
Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.997 |
30% Bioavailability (F30%): | 0.963 |
Blood-Brain-Barrier Penetration (BBB): | 0.337 | Plasma Protein Binding (PPB): | 88.99% |
Volume Distribution (VD): | 1.079 | Fu: | 5.12% |
CYP1A2-inhibitor: | 0.192 | CYP1A2-substrate: | 0.178 |
CYP2C19-inhibitor: | 0.829 | CYP2C19-substrate: | 0.103 |
CYP2C9-inhibitor: | 0.76 | CYP2C9-substrate: | 0.618 |
CYP2D6-inhibitor: | 0.837 | CYP2D6-substrate: | 0.358 |
CYP3A4-inhibitor: | 0.936 | CYP3A4-substrate: | 0.404 |
Clearance (CL): | 2.957 | Half-life (T1/2): | 0.167 |
hERG Blockers: | 0.081 | Human Hepatotoxicity (H-HT): | 0.835 |
Drug-inuced Liver Injury (DILI): | 0.652 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.914 | Maximum Recommended Daily Dose: | 0.422 |
Skin Sensitization: | 0.198 | Carcinogencity: | 0.123 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.973 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000859 | ![]() |
0.851 | D06BLQ | ![]() |
0.214 | ||
ENC003867 | ![]() |
0.810 | D0Q0PR | ![]() |
0.209 | ||
ENC003866 | ![]() |
0.810 | D03VFL | ![]() |
0.201 | ||
ENC004457 | ![]() |
0.626 | D0W7WC | ![]() |
0.193 | ||
ENC005008 | ![]() |
0.622 | D0Q8NJ | ![]() |
0.187 | ||
ENC002069 | ![]() |
0.596 | D0O6KE | ![]() |
0.186 | ||
ENC002068 | ![]() |
0.582 | D02SBQ | ![]() |
0.185 | ||
ENC003796 | ![]() |
0.562 | D0NG7O | ![]() |
0.183 | ||
ENC002460 | ![]() |
0.450 | D06FVX | ![]() |
0.183 | ||
ENC002630 | ![]() |
0.438 | D0R0MW | ![]() |
0.182 |