![]() |
Name |
Terezine D
|
Molecular Formula | C19H23N3O2 | |
IUPAC Name* |
(3S,6S)-3-methyl-6-[[7-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]piperazine-2,5-dione
|
|
SMILES |
C[C@H]1C(=O)N[C@H](C(=O)N1)CC2=CNC3=C(C=CC=C23)CC=C(C)C
|
|
InChI |
InChI=1S/C19H23N3O2/c1-11(2)7-8-13-5-4-6-15-14(10-20-17(13)15)9-16-19(24)21-12(3)18(23)22-16/h4-7,10,12,16,20H,8-9H2,1-3H3,(H,21,24)(H,22,23)/t12-,16-/m0/s1
|
|
InChIKey |
IHJVJWQYVQWURS-LRDDRELGSA-N
|
|
Synonyms |
Terezine D; Terezin D; CHEMBL513584; MEGxm0_000106; (3S,6S)-3-methyl-6-[[7-(3-methylbut-2-enyl)-1H-indol-3-yl]methyl]piperazine-2,5-dione
|
|
CAS | NA | |
PubChem CID | 10245773 | |
ChEMBL ID | CHEMBL513584 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 325.4 | ALogp: | 3.1 |
HBD: | 3 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.756 |
Caco-2 Permeability: | -4.928 | MDCK Permeability: | 0.00000441 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.557 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.928 |
30% Bioavailability (F30%): | 0.981 |
Blood-Brain-Barrier Penetration (BBB): | 0.736 | Plasma Protein Binding (PPB): | 83.57% |
Volume Distribution (VD): | 0.931 | Fu: | 11.37% |
CYP1A2-inhibitor: | 0.364 | CYP1A2-substrate: | 0.212 |
CYP2C19-inhibitor: | 0.855 | CYP2C19-substrate: | 0.075 |
CYP2C9-inhibitor: | 0.406 | CYP2C9-substrate: | 0.704 |
CYP2D6-inhibitor: | 0.319 | CYP2D6-substrate: | 0.675 |
CYP3A4-inhibitor: | 0.727 | CYP3A4-substrate: | 0.226 |
Clearance (CL): | 7.16 | Half-life (T1/2): | 0.758 |
hERG Blockers: | 0.063 | Human Hepatotoxicity (H-HT): | 0.892 |
Drug-inuced Liver Injury (DILI): | 0.711 | AMES Toxicity: | 0.076 |
Rat Oral Acute Toxicity: | 0.789 | Maximum Recommended Daily Dose: | 0.813 |
Skin Sensitization: | 0.107 | Carcinogencity: | 0.072 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.234 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002069 | ![]() |
0.640 | D0NG7O | ![]() |
0.270 | ||
ENC003864 | ![]() |
0.505 | D0AN7B | ![]() |
0.250 | ||
ENC002068 | ![]() |
0.505 | D0N1WU | ![]() |
0.235 | ||
ENC006005 | ![]() |
0.488 | D0Z6UC | ![]() |
0.232 | ||
ENC004711 | ![]() |
0.482 | D05EJG | ![]() |
0.225 | ||
ENC002631 | ![]() |
0.478 | D09ZIO | ![]() |
0.222 | ||
ENC002460 | ![]() |
0.460 | D0X7KB | ![]() |
0.221 | ||
ENC000859 | ![]() |
0.445 | D0BV3J | ![]() |
0.221 | ||
ENC003866 | ![]() |
0.434 | D02DMQ | ![]() |
0.218 | ||
ENC003867 | ![]() |
0.434 | D0QD1G | ![]() |
0.218 |