|
Name |
Fumigaclavine A
|
| Molecular Formula | C18H22N2O2 | |
| IUPAC Name* |
[(6aR,9R,10S,10aR)-7,9-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-10-yl] acetate
|
|
| SMILES |
C[C@@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)[C@H]2[C@H]1OC(=O)C)C
|
|
| InChI |
InChI=1S/C18H22N2O2/c1-10-9-20(3)15-7-12-8-19-14-6-4-5-13(16(12)14)17(15)18(10)22-11(2)21/h4-6,8,10,15,17-19H,7,9H2,1-3H3/t10-,15-,17-,18+/m1/s1
|
|
| InChIKey |
GJSSYQDXZLZOLR-ONUGHKICSA-N
|
|
| Synonyms |
Fumigaclavine A; 6879-59-0; DV9FK5AO1K; UNII-DV9FK5AO1K; Fumigaclavin A; DTXSID40988499; Ergolin-9-ol, 6,8-dimethyl-, acetate (ester), (8-alpha,9-beta)-; C20436; ERGOLIN-9-OL, 6,8-DIMETHYL-, 9-ACETATE, (8.ALPHA.,9.BETA.)-; ERGOLIN-9-OL, 6,8-DIMETHYL-, ACETATE (ESTER), (8.ALPHA.,9.BETA.); (2R,3S,4R,7R)-4,6-dimethyl-6,11-diazatetracyclo[7.6.1.0?,?.0??,??]hexadeca-1(15),9,12(16),13-tetraen-3-yl acetate; [(6Ar,9R,10S,10aR)-7,9-dimethyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-10-yl] acetate
|
|
| CAS | 6879-59-0 | |
| PubChem CID | 5324492 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 298.4 | ALogp: | 2.8 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 45.3 | Aromatic Rings: | 4 |
| Heavy Atoms: | 22 | QED Weighted: | 0.82 |
| Caco-2 Permeability: | -4.788 | MDCK Permeability: | 0.00001550 |
| Pgp-inhibitor: | 0.878 | Pgp-substrate: | 0.969 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.231 |
| Blood-Brain-Barrier Penetration (BBB): | 0.892 | Plasma Protein Binding (PPB): | 42.38% |
| Volume Distribution (VD): | 1.896 | Fu: | 55.68% |
| CYP1A2-inhibitor: | 0.74 | CYP1A2-substrate: | 0.144 |
| CYP2C19-inhibitor: | 0.106 | CYP2C19-substrate: | 0.839 |
| CYP2C9-inhibitor: | 0.064 | CYP2C9-substrate: | 0.447 |
| CYP2D6-inhibitor: | 0.971 | CYP2D6-substrate: | 0.883 |
| CYP3A4-inhibitor: | 0.649 | CYP3A4-substrate: | 0.714 |
| Clearance (CL): | 6.896 | Half-life (T1/2): | 0.824 |
| hERG Blockers: | 0.637 | Human Hepatotoxicity (H-HT): | 0.948 |
| Drug-inuced Liver Injury (DILI): | 0.867 | AMES Toxicity: | 0.774 |
| Rat Oral Acute Toxicity: | 0.881 | Maximum Recommended Daily Dose: | 0.924 |
| Skin Sensitization: | 0.815 | Carcinogencity: | 0.069 |
| Eye Corrosion: | 0.012 | Eye Irritation: | 0.044 |
| Respiratory Toxicity: | 0.967 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002408 | ![]() |
0.706 | D04JCN | ![]() |
0.432 | ||
| ENC003002 | ![]() |
0.619 | D0X7KB | ![]() |
0.400 | ||
| ENC001993 | ![]() |
0.439 | D0C1IW | ![]() |
0.398 | ||
| ENC002600 | ![]() |
0.438 | D05AHE | ![]() |
0.385 | ||
| ENC003506 | ![]() |
0.379 | D04EGX | ![]() |
0.372 | ||
| ENC006111 | ![]() |
0.376 | D02IQY | ![]() |
0.341 | ||
| ENC002599 | ![]() |
0.355 | D0T6WT | ![]() |
0.327 | ||
| ENC006011 | ![]() |
0.355 | D0V3ZA | ![]() |
0.321 | ||
| ENC006110 | ![]() |
0.337 | D09NNH | ![]() |
0.319 | ||
| ENC001258 | ![]() |
0.327 | D0SP3D | ![]() |
0.309 | ||