|
Name |
Clavicipitic acid
|
| Molecular Formula | C16H18N2O2 | |
| IUPAC Name* |
9-(2-methylprop-1-enyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxylic acid
|
|
| SMILES |
CC(=CC1C2=C3C(=CNC3=CC=C2)CC(N1)C(=O)O)C
|
|
| InChI |
InChI=1S/C16H18N2O2/c1-9(2)6-13-11-4-3-5-12-15(11)10(8-17-12)7-14(18-13)16(19)20/h3-6,8,13-14,17-18H,7H2,1-2H3,(H,19,20)
|
|
| InChIKey |
VZMAHZAQMKNJIG-UHFFFAOYSA-N
|
|
| Synonyms |
clavicipitic acid; CHEBI:23325; Q27109796; 6-(2-methylprop-1-en-1-yl)-3,4,5,6-tetrahydro-1H-azepino[5,4,3-cd]indole-4-carboxylic acid; 9-(2-methylprop-1-enyl)-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxylic acid
|
|
| CAS | NA | |
| PubChem CID | 10265155 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 270.33 | ALogp: | 0.5 |
| HBD: | 3 | HBA: | 3 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 65.1 | Aromatic Rings: | 3 |
| Heavy Atoms: | 20 | QED Weighted: | 0.731 |
| Caco-2 Permeability: | -4.961 | MDCK Permeability: | 0.00000535 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.01 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.35 |
| Blood-Brain-Barrier Penetration (BBB): | 0.564 | Plasma Protein Binding (PPB): | 66.67% |
| Volume Distribution (VD): | 1.397 | Fu: | 28.13% |
| CYP1A2-inhibitor: | 0.194 | CYP1A2-substrate: | 0.575 |
| CYP2C19-inhibitor: | 0.208 | CYP2C19-substrate: | 0.071 |
| CYP2C9-inhibitor: | 0.146 | CYP2C9-substrate: | 0.92 |
| CYP2D6-inhibitor: | 0.066 | CYP2D6-substrate: | 0.719 |
| CYP3A4-inhibitor: | 0.035 | CYP3A4-substrate: | 0.104 |
| Clearance (CL): | 1.619 | Half-life (T1/2): | 0.822 |
| hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.978 |
| Drug-inuced Liver Injury (DILI): | 0.838 | AMES Toxicity: | 0.073 |
| Rat Oral Acute Toxicity: | 0.92 | Maximum Recommended Daily Dose: | 0.921 |
| Skin Sensitization: | 0.165 | Carcinogencity: | 0.146 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.941 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001635 | ![]() |
0.439 | D04JCN | ![]() |
0.364 | ||
| ENC002408 | ![]() |
0.429 | D0C1IW | ![]() |
0.363 | ||
| ENC006111 | ![]() |
0.386 | D05AHE | ![]() |
0.351 | ||
| ENC006110 | ![]() |
0.374 | D0X7KB | ![]() |
0.337 | ||
| ENC003506 | ![]() |
0.374 | D04EGX | ![]() |
0.330 | ||
| ENC004047 | ![]() |
0.310 | D05EJG | ![]() |
0.273 | ||
| ENC005757 | ![]() |
0.304 | D02IQY | ![]() |
0.259 | ||
| ENC000953 | ![]() |
0.304 | D0AN7B | ![]() |
0.253 | ||
| ENC002914 | ![]() |
0.304 | D0V3ZA | ![]() |
0.252 | ||
| ENC003358 | ![]() |
0.304 | D0K0KH | ![]() |
0.245 | ||