|
Name |
9-deacetoxyfumigaclavine C
|
| Molecular Formula | C21H28N2 | |
| IUPAC Name* |
(6aR,9R,10aR)-7,9-dimethyl-5-(2-methylbut-3-en-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline
|
|
| SMILES |
C[C@@H]1C[C@H]2[C@@H](CC3=C(NC4=CC=CC2=C34)C(C)(C)C=C)N(C1)C
|
|
| InChI |
InChI=1S/C21H28N2/c1-6-21(3,4)20-16-11-18-15(10-13(2)12-23(18)5)14-8-7-9-17(22-20)19(14)16/h6-9,13,15,18,22H,1,10-12H2,2-5H3/t13-,15-,18-/m1/s1
|
|
| InChIKey |
GXEMWNLJOIOIIM-DDUZABMNSA-N
|
|
| Synonyms |
9-deacetoxyfumigaclavine C; CHEBI:65724; (8beta)-6,8-dimethyl-2-(2-methylbut-3-en-2-yl)ergoline; CHEMBL561363; Q15964534
|
|
| CAS | NA | |
| PubChem CID | 42640299 | |
| ChEMBL ID | CHEMBL561363 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 308.5 | ALogp: | 5.1 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 19.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 23 | QED Weighted: | 0.767 |
| Caco-2 Permeability: | -4.958 | MDCK Permeability: | 0.00001380 |
| Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.672 |
| Human Intestinal Absorption (HIA): | 0.018 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.16 |
| Blood-Brain-Barrier Penetration (BBB): | 0.962 | Plasma Protein Binding (PPB): | 93.03% |
| Volume Distribution (VD): | 2.228 | Fu: | 6.98% |
| CYP1A2-inhibitor: | 0.547 | CYP1A2-substrate: | 0.937 |
| CYP2C19-inhibitor: | 0.35 | CYP2C19-substrate: | 0.959 |
| CYP2C9-inhibitor: | 0.076 | CYP2C9-substrate: | 0.615 |
| CYP2D6-inhibitor: | 0.977 | CYP2D6-substrate: | 0.924 |
| CYP3A4-inhibitor: | 0.363 | CYP3A4-substrate: | 0.909 |
| Clearance (CL): | 3.29 | Half-life (T1/2): | 0.208 |
| hERG Blockers: | 0.774 | Human Hepatotoxicity (H-HT): | 0.486 |
| Drug-inuced Liver Injury (DILI): | 0.28 | AMES Toxicity: | 0.032 |
| Rat Oral Acute Toxicity: | 0.956 | Maximum Recommended Daily Dose: | 0.955 |
| Skin Sensitization: | 0.885 | Carcinogencity: | 0.174 |
| Eye Corrosion: | 0.015 | Eye Irritation: | 0.051 |
| Respiratory Toxicity: | 0.969 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC006011 | ![]() |
1.000 | D04JCN | ![]() |
0.347 | ||
| ENC002600 | ![]() |
0.711 | D04EGX | ![]() |
0.308 | ||
| ENC003002 | ![]() |
0.643 | D02IQY | ![]() |
0.307 | ||
| ENC002408 | ![]() |
0.372 | D0UA0I | ![]() |
0.302 | ||
| ENC001635 | ![]() |
0.355 | D0U7GP | ![]() |
0.264 | ||
| ENC002214 | ![]() |
0.350 | D01JGV | ![]() |
0.264 | ||
| ENC004928 | ![]() |
0.350 | D0X7KB | ![]() |
0.262 | ||
| ENC004933 | ![]() |
0.343 | D0C1IW | ![]() |
0.257 | ||
| ENC002631 | ![]() |
0.340 | D0V3ZA | ![]() |
0.255 | ||
| ENC004930 | ![]() |
0.340 | D09NNH | ![]() |
0.255 | ||