![]() |
Name |
Methyl 2-(((5-bromo-2-(4-methoxybenzamido)phenyl)(phenyl)methyl)amino)acetate
|
Molecular Formula | C24H23BrN2O4 | |
IUPAC Name* |
methyl 2-[[[5-bromo-2-[(4-methoxybenzoyl)amino]phenyl]-phenylmethyl]amino]acetate
|
|
SMILES |
COC1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)Br)C(C3=CC=CC=C3)NCC(=O)OC
|
|
InChI |
InChI=1S/C24H23BrN2O4/c1-30-19-11-8-17(9-12-19)24(29)27-21-13-10-18(25)14-20(21)23(26-15-22(28)31-2)16-6-4-3-5-7-16/h3-14,23,26H,15H2,1-2H3,(H,27,29)
|
|
InChIKey |
GYKWHELBXXZEIE-UHFFFAOYSA-N
|
|
Synonyms |
381680-03-1; methyl 2-(((5-bromo-2-(4-methoxybenzamido)phenyl)(phenyl)methyl)amino)acetate; methyl 2-({[5-bromo-2-(4-methoxybenzamido)phenyl](phenyl)methyl}amino)acetate; CHEMBL590645; STL330562; AKOS001058209; AKOS022118713; methyl 2-[[[5-bromo-2-[(4-methoxybenzoyl)amino]phenyl]-phenylmethyl]amino]acetate; SJ000247056; Z56851734; F1551-0033; methyl N-[(5-bromo-2-{[(4-methoxyphenyl)carbonyl]amino}phenyl)(phenyl)methyl]glycinate
|
|
CAS | NA | |
PubChem CID | 3814416 | |
ChEMBL ID | CHEMBL590645 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 483.4 | ALogp: | 5.0 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 31 | QED Weighted: | 0.44 |
Caco-2 Permeability: | -5.097 | MDCK Permeability: | 0.00001400 |
Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.273 |
Blood-Brain-Barrier Penetration (BBB): | 0.947 | Plasma Protein Binding (PPB): | 94.43% |
Volume Distribution (VD): | 1.155 | Fu: | 5.09% |
CYP1A2-inhibitor: | 0.441 | CYP1A2-substrate: | 0.73 |
CYP2C19-inhibitor: | 0.959 | CYP2C19-substrate: | 0.795 |
CYP2C9-inhibitor: | 0.926 | CYP2C9-substrate: | 0.888 |
CYP2D6-inhibitor: | 0.906 | CYP2D6-substrate: | 0.878 |
CYP3A4-inhibitor: | 0.944 | CYP3A4-substrate: | 0.867 |
Clearance (CL): | 1.258 | Half-life (T1/2): | 0.284 |
hERG Blockers: | 0.78 | Human Hepatotoxicity (H-HT): | 0.932 |
Drug-inuced Liver Injury (DILI): | 0.968 | AMES Toxicity: | 0.128 |
Rat Oral Acute Toxicity: | 0.37 | Maximum Recommended Daily Dose: | 0.941 |
Skin Sensitization: | 0.095 | Carcinogencity: | 0.048 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.138 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002247 | ![]() |
0.336 | D0J0BU | ![]() |
0.405 | ||
ENC001352 | ![]() |
0.327 | D0L0SW | ![]() |
0.373 | ||
ENC001307 | ![]() |
0.325 | D0S5RZ | ![]() |
0.367 | ||
ENC001456 | ![]() |
0.324 | D08QIP | ![]() |
0.366 | ||
ENC004474 | ![]() |
0.319 | D07IEF | ![]() |
0.352 | ||
ENC000298 | ![]() |
0.315 | D0Y4QG | ![]() |
0.343 | ||
ENC001805 | ![]() |
0.315 | D0J1MI | ![]() |
0.336 | ||
ENC000209 | ![]() |
0.305 | D0F4NS | ![]() |
0.336 | ||
ENC002858 | ![]() |
0.300 | D07KSG | ![]() |
0.331 | ||
ENC002396 | ![]() |
0.298 | D00WCX | ![]() |
0.331 |