|
Name |
Methyl 4-methoxybenzoate
|
| Molecular Formula | C9H10O3 | |
| IUPAC Name* |
methyl 4-methoxybenzoate
|
|
| SMILES |
COC1=CC=C(C=C1)C(=O)OC
|
|
| InChI |
InChI=1S/C9H10O3/c1-11-8-5-3-7(4-6-8)9(10)12-2/h3-6H,1-2H3
|
|
| InChIKey |
DDIZAANNODHTRB-UHFFFAOYSA-N
|
|
| Synonyms |
METHYL 4-METHOXYBENZOATE; 121-98-2; Methyl p-anisate; Methyl anisate; Methyl p-methoxybenzoate; Benzoic acid, 4-methoxy-, methyl ester; Methyl 4-Anisate; 4-Methoxybenzoic acid methyl ester; p-Anisic acid, methyl ester; p-Methoxybenzoic acid methyl ester; p-Anisic acid methyl ester; FEMA No. 2679; Benzoic acid, p-methoxy-, methyl ester; NSC 7324; 4-methoxy methylbenzoate; NSC-7324; CHEMBL1762668; CHEBI:86903; NSC7324; 2MFL7873W9; 4-methoxy-benzoic acid methyl ester; Methyl ester of p-Methoxybenzoic acid; MFCD00008437; methyl4-methoxybenzoate; methyl P-methoxy benzoate; EINECS 204-513-2; METHYL PARA-ANISATE; anisate; BRN 2208571; UNII-2MFL7873W9; AI3-00229; Methyl-p-anisate; FEMA 2679; Methyl p-anisate, 99%; bmse010016; WLN: 1OVR DO1; DSSTox_CID_27645; DSSTox_RID_82472; 4-Methoxybenzoic acid methyl; DSSTox_GSID_47645; METHYL ANISATE [FHFI]; SCHEMBL231243; F1335-0002; METHYL-4-METHOXYBENZOATE; DTXSID7047645; ZINC87933; Methyl p-anisate, >=99%, FG; NSC7324NSC 7324; Tox21_302682; AC7521; BDBM50340087; PARA-ANISIC ACID METHYL ESTER; STK041805; AKOS000501135; AC-7084; CS-W016058; HY-W015342; NCGC00256751-01; CAS-121-98-2; DS-13900; SY003911; Methyl p-anisate, >=99% (capillary GC); DB-012814; A1125; AM20050128; FT-0628647; FT-0671960; EN300-107567; AQ-917/40232598; METHYL SALICYLATE IMPURITY D [EP IMPURITY]; Q6823933; W-108443
|
|
| CAS | 121-98-2 | |
| PubChem CID | 8499 | |
| ChEMBL ID | CHEMBL1762668 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 166.17 | ALogp: | 2.3 |
| HBD: | 0 | HBA: | 3 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 35.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 12 | QED Weighted: | 0.63 |
| Caco-2 Permeability: | -4.437 | MDCK Permeability: | 0.00003210 |
| Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.014 |
| 30% Bioavailability (F30%): | 0.956 |
| Blood-Brain-Barrier Penetration (BBB): | 0.783 | Plasma Protein Binding (PPB): | 83.43% |
| Volume Distribution (VD): | 0.796 | Fu: | 14.25% |
| CYP1A2-inhibitor: | 0.977 | CYP1A2-substrate: | 0.953 |
| CYP2C19-inhibitor: | 0.917 | CYP2C19-substrate: | 0.647 |
| CYP2C9-inhibitor: | 0.286 | CYP2C9-substrate: | 0.874 |
| CYP2D6-inhibitor: | 0.211 | CYP2D6-substrate: | 0.874 |
| CYP3A4-inhibitor: | 0.192 | CYP3A4-substrate: | 0.281 |
| Clearance (CL): | 10.874 | Half-life (T1/2): | 0.845 |
| hERG Blockers: | 0.137 | Human Hepatotoxicity (H-HT): | 0.075 |
| Drug-inuced Liver Injury (DILI): | 0.584 | AMES Toxicity: | 0.013 |
| Rat Oral Acute Toxicity: | 0.024 | Maximum Recommended Daily Dose: | 0.018 |
| Skin Sensitization: | 0.574 | Carcinogencity: | 0.227 |
| Eye Corrosion: | 0.04 | Eye Irritation: | 0.986 |
| Respiratory Toxicity: | 0.11 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000201 | ![]() |
0.703 | D02DPU | ![]() |
0.472 | ||
| ENC000195 | ![]() |
0.615 | D0Q8ZX | ![]() |
0.435 | ||
| ENC000785 | ![]() |
0.532 | D0J5DC | ![]() |
0.357 | ||
| ENC000221 | ![]() |
0.526 | D0TZ1G | ![]() |
0.356 | ||
| ENC001806 | ![]() |
0.511 | D0DJ1B | ![]() |
0.356 | ||
| ENC000318 | ![]() |
0.487 | D05CKR | ![]() |
0.350 | ||
| ENC001578 | ![]() |
0.471 | D05PHH | ![]() |
0.329 | ||
| ENC005495 | ![]() |
0.469 | D08HQK | ![]() |
0.323 | ||
| ENC001441 | ![]() |
0.468 | D02XJY | ![]() |
0.323 | ||
| ENC000638 | ![]() |
0.457 | D03XTC | ![]() |
0.319 | ||