|
Name |
P-Methoxystilbene
|
| Molecular Formula | C15H14O | |
| IUPAC Name* |
1-methoxy-4-[(E)-2-phenylethenyl]benzene
|
|
| SMILES |
COC1=CC=C(C=C1)/C=C/C2=CC=CC=C2
|
|
| InChI |
InChI=1S/C15H14O/c1-16-15-11-9-14(10-12-15)8-7-13-5-3-2-4-6-13/h2-12H,1H3/b8-7+
|
|
| InChIKey |
XWYXLYCDZKRCAD-BQYQJAHWSA-N
|
|
| Synonyms |
4-Methoxystilbene; P-METHOXYSTILBENE; 1142-15-0; 1694-19-5; 4-Methoxy-trans-stilbene; trans-4-Methoxystilbene; 1-Methoxy-4-((E)-styryl)-benzene; Anisole, p-styryl-; (E)-4-Methoxystilbene; 1-(p-Methoxyphenyl)-2-phenylethene; Benzene, 1-methoxy-4-(2-phenylethenyl)-; 1-Methoxy-4-[(E)-2-phenylethenyl]benzene; 1-Methoxy-4-(2-phenylethenyl)benzene; 1-Methoxy-4-styrylbenzene; 1-Methoxy-4-(2-phenylethenyl)-benzene; CHEBI:35094; 5EL148B7HG; CHEMBL2387063; NSC-2139; Benzene,1-methoxy-4-(2-phenylethenyl)-; UNII-5EL148B7HG; p-Methoxystilben; Anisole,p-styryl-; EINECS 214-530-7; MFCD00017178; trans-p-Methoxystilbene; 4-Methoxy-trans-stilben; METHOXYSTILBENE ,4-; SCHEMBL699620; SCHEMBL699621; STILBENE, 4-METHOXY-; (e)-1-methoxy-4-styrylbenzene; XWYXLYCDZKRCAD-BQYQJAHWSA-; NSC2139; BAA69419; NSC 2139; ZINC1054440; 1-(4-methoxyphenyl)-2-phenylethene; BDBM50140154; LMPK13090021; NSC149956; STK751066; AKOS001720565; NSC-149956; PS-8014; NCGC00332015-01; AC-20796; AS-64321; CS-0206534; M2964; 1-(P-METHOXY)PHENYL-2-PHENYLETHYLENE; 1-methoxy-4-[(E)-2-phenyl-1-ethenyl]benzene; 1-Phenyl-2-(4-methoxy-phenyl)-A currencythylen; AB01325670-02; A803152; 2-(4-Nitrophenyl)oxazole-4-carboxylicacidethylester; J-003061; Q27116413
|
|
| CAS | 1142-15-0 | |
| PubChem CID | 1245920 | |
| ChEMBL ID | CHEMBL2387063 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 210.27 | ALogp: | 4.4 |
| HBD: | 0 | HBA: | 1 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 9.2 | Aromatic Rings: | 2 |
| Heavy Atoms: | 16 | QED Weighted: | 0.676 |
| Caco-2 Permeability: | -4.7 | MDCK Permeability: | 0.00001250 |
| Pgp-inhibitor: | 0.254 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.268 |
| 30% Bioavailability (F30%): | 0.298 |
| Blood-Brain-Barrier Penetration (BBB): | 0.399 | Plasma Protein Binding (PPB): | 98.04% |
| Volume Distribution (VD): | 0.804 | Fu: | 1.49% |
| CYP1A2-inhibitor: | 0.983 | CYP1A2-substrate: | 0.804 |
| CYP2C19-inhibitor: | 0.856 | CYP2C19-substrate: | 0.137 |
| CYP2C9-inhibitor: | 0.581 | CYP2C9-substrate: | 0.932 |
| CYP2D6-inhibitor: | 0.472 | CYP2D6-substrate: | 0.872 |
| CYP3A4-inhibitor: | 0.609 | CYP3A4-substrate: | 0.487 |
| Clearance (CL): | 7.7 | Half-life (T1/2): | 0.248 |
| hERG Blockers: | 0.446 | Human Hepatotoxicity (H-HT): | 0.058 |
| Drug-inuced Liver Injury (DILI): | 0.822 | AMES Toxicity: | 0.83 |
| Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.065 |
| Skin Sensitization: | 0.939 | Carcinogencity: | 0.744 |
| Eye Corrosion: | 0.316 | Eye Irritation: | 0.993 |
| Respiratory Toxicity: | 0.031 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000801 | ![]() |
0.717 | D0H6TP | ![]() |
0.444 | ||
| ENC001460 | ![]() |
0.500 | D09WKB | ![]() |
0.423 | ||
| ENC001441 | ![]() |
0.456 | D0L1WV | ![]() |
0.412 | ||
| ENC001428 | ![]() |
0.433 | D00HPK | ![]() |
0.400 | ||
| ENC000207 | ![]() |
0.429 | D01ZJK | ![]() |
0.368 | ||
| ENC001446 | ![]() |
0.417 | D0TR5X | ![]() |
0.363 | ||
| ENC001578 | ![]() |
0.413 | D0Y7EM | ![]() |
0.348 | ||
| ENC000209 | ![]() |
0.412 | D03XYW | ![]() |
0.342 | ||
| ENC002253 | ![]() |
0.409 | D02WCI | ![]() |
0.338 | ||
| ENC001523 | ![]() |
0.408 | D0Y5GK | ![]() |
0.333 | ||