|
Name |
4''-Deoxyterphenyllin
|
| Molecular Formula | C20H18O4 | |
| IUPAC Name* |
2-(4-hydroxyphenyl)-3,6-dimethoxy-5-phenylphenol
|
|
| SMILES |
COC1=C(C(=C(C(=C1)C2=CC=CC=C2)OC)O)C3=CC=C(C=C3)O
|
|
| InChI |
InChI=1S/C20H18O4/c1-23-17-12-16(13-6-4-3-5-7-13)20(24-2)19(22)18(17)14-8-10-15(21)11-9-14/h3-12,21-22H,1-2H3
|
|
| InChIKey |
LVUGIAPKIURDNR-UHFFFAOYSA-N
|
|
| Synonyms |
4''-Deoxyterphenyllin; CHEBI:67535; P8MM2CV9BY; 59904-04-0; CHEMBL1951870; (1,1':4',1''-Terphenyl)-2',4-diol, 3',6'-dimethoxy-; 4-Deoxyterphenyllin; 4'-Deoxyterphenyllin; UNII-P8MM2CV9BY; 4''''-Deoxyterphenyllin; DTXSID201236995; BDBM50457918; Q27136004; 3',6'-dimethoxy-1,1':4',1''-terphenyl-2',4-diol; 3',6'-Dimethoxy[1,1':4',1''-terphenyl]-2',4-diol
|
|
| CAS | 59904-04-0 | |
| PubChem CID | 57345621 | |
| ChEMBL ID | CHEMBL1951870 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 322.4 | ALogp: | 4.4 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 58.9 | Aromatic Rings: | 3 |
| Heavy Atoms: | 24 | QED Weighted: | 0.713 |
| Caco-2 Permeability: | -4.831 | MDCK Permeability: | 0.00001830 |
| Pgp-inhibitor: | 0.028 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.036 |
| 30% Bioavailability (F30%): | 0.024 |
| Blood-Brain-Barrier Penetration (BBB): | 0.064 | Plasma Protein Binding (PPB): | 99.68% |
| Volume Distribution (VD): | 0.624 | Fu: | 1.01% |
| CYP1A2-inhibitor: | 0.954 | CYP1A2-substrate: | 0.846 |
| CYP2C19-inhibitor: | 0.961 | CYP2C19-substrate: | 0.072 |
| CYP2C9-inhibitor: | 0.806 | CYP2C9-substrate: | 0.931 |
| CYP2D6-inhibitor: | 0.487 | CYP2D6-substrate: | 0.914 |
| CYP3A4-inhibitor: | 0.608 | CYP3A4-substrate: | 0.474 |
| Clearance (CL): | 5.995 | Half-life (T1/2): | 0.606 |
| hERG Blockers: | 0.186 | Human Hepatotoxicity (H-HT): | 0.036 |
| Drug-inuced Liver Injury (DILI): | 0.882 | AMES Toxicity: | 0.145 |
| Rat Oral Acute Toxicity: | 0.113 | Maximum Recommended Daily Dose: | 0.026 |
| Skin Sensitization: | 0.579 | Carcinogencity: | 0.172 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.557 |
| Respiratory Toxicity: | 0.121 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005037 | ![]() |
0.805 | D0L6DA | ![]() |
0.383 | ||
| ENC000826 | ![]() |
0.747 | D0H6TP | ![]() |
0.383 | ||
| ENC002759 | ![]() |
0.747 | D0Y7EM | ![]() |
0.373 | ||
| ENC005870 | ![]() |
0.720 | D0Q9ON | ![]() |
0.371 | ||
| ENC005871 | ![]() |
0.720 | D0R2OA | ![]() |
0.362 | ||
| ENC005039 | ![]() |
0.687 | D06TJJ | ![]() |
0.359 | ||
| ENC002453 | ![]() |
0.656 | D05UWI | ![]() |
0.356 | ||
| ENC005869 | ![]() |
0.640 | D05VLS | ![]() |
0.354 | ||
| ENC005866 | ![]() |
0.634 | D0YB1G | ![]() |
0.351 | ||
| ENC005865 | ![]() |
0.634 | D09VXM | ![]() |
0.350 | ||