![]() |
Name |
N,N-Diphenyl-2-nitro-thiobenzamide
|
Molecular Formula | C19H14N2O2S | |
IUPAC Name* |
2-nitro-N,N-diphenylbenzenecarbothioamide
|
|
SMILES |
C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=S)C3=CC=CC=C3[N+](=O)[O-]
|
|
InChI |
InChI=1S/C19H14N2O2S/c22-21(23)18-14-8-7-13-17(18)19(24)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H
|
|
InChIKey |
ZJRUJXMKOPFCDH-UHFFFAOYSA-N
|
|
Synonyms |
N,N-Diphenyl-2-nitro-thiobenzamide; 2-Nitro-N,N-diphenylbenzenecarbothioamide #
|
|
CAS | NA | |
PubChem CID | 625377 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 334.4 | ALogp: | 4.9 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 81.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.363 |
Caco-2 Permeability: | -4.811 | MDCK Permeability: | 0.00015311 |
Pgp-inhibitor: | 0.942 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0 |
Blood-Brain-Barrier Penetration (BBB): | 0.373 | Plasma Protein Binding (PPB): | 98.22% |
Volume Distribution (VD): | 0.882 | Fu: | 1.78% |
CYP1A2-inhibitor: | 0.675 | CYP1A2-substrate: | 0.133 |
CYP2C19-inhibitor: | 0.937 | CYP2C19-substrate: | 0.381 |
CYP2C9-inhibitor: | 0.918 | CYP2C9-substrate: | 0.818 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.329 |
CYP3A4-inhibitor: | 0.336 | CYP3A4-substrate: | 0.837 |
Clearance (CL): | 1.846 | Half-life (T1/2): | 0.156 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.801 |
Drug-inuced Liver Injury (DILI): | 0.984 | AMES Toxicity: | 0.093 |
Rat Oral Acute Toxicity: | 0.192 | Maximum Recommended Daily Dose: | 0.085 |
Skin Sensitization: | 0.768 | Carcinogencity: | 0.749 |
Eye Corrosion: | 0.11 | Eye Irritation: | 0.905 |
Respiratory Toxicity: | 0.552 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000894 | ![]() |
0.396 | D09GOS | ![]() |
0.388 | ||
ENC000093 | ![]() |
0.375 | D03DEI | ![]() |
0.366 | ||
ENC000295 | ![]() |
0.353 | D0G1VX | ![]() |
0.349 | ||
ENC000077 | ![]() |
0.349 | D06FZX | ![]() |
0.344 | ||
ENC001018 | ![]() |
0.347 | D0AA2D | ![]() |
0.343 | ||
ENC001428 | ![]() |
0.341 | D0Q3YO | ![]() |
0.342 | ||
ENC001050 | ![]() |
0.341 | D00HPK | ![]() |
0.340 | ||
ENC000461 | ![]() |
0.337 | D07KSG | ![]() |
0.339 | ||
ENC005604 | ![]() |
0.330 | D02CTS | ![]() |
0.333 | ||
ENC000302 | ![]() |
0.330 | D0U3ED | ![]() |
0.333 |