![]() |
Name |
Methyl 3-hydroxyoctadecanoate
|
Molecular Formula | C19H38O3 | |
IUPAC Name* |
methyl 3-hydroxyoctadecanoate
|
|
SMILES |
CCCCCCCCCCCCCCCC(CC(=O)OC)O
|
|
InChI |
InChI=1S/C19H38O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(20)17-19(21)22-2/h18,20H,3-17H2,1-2H3
|
|
InChIKey |
XIGHAQIRKIFLFB-UHFFFAOYSA-N
|
|
Synonyms |
Methyl 3-hydroxyoctadecanoate; 2420-36-2; 3-Hydroxyoctadecanoic acid methyl ester; Octadecanoic acid, 3-hydroxy-, methyl ester; 14531-40-9; Methyl 3-Hydroxyoctadecanoate, (C18); SCHEMBL3127385; DTXSID10337117; AKOS030240075; J-008085
|
|
CAS | 2420-36-2 | |
PubChem CID | 538801 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 314.5 | ALogp: | 7.2 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 17 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 46.5 | Aromatic Rings: | 0 |
Heavy Atoms: | 22 | QED Weighted: | 0.297 |
Caco-2 Permeability: | -4.736 | MDCK Permeability: | 0.00002360 |
Pgp-inhibitor: | 0.068 | Pgp-substrate: | 0.656 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.993 |
30% Bioavailability (F30%): | 0.987 |
Blood-Brain-Barrier Penetration (BBB): | 0.511 | Plasma Protein Binding (PPB): | 97.32% |
Volume Distribution (VD): | 0.691 | Fu: | 1.52% |
CYP1A2-inhibitor: | 0.489 | CYP1A2-substrate: | 0.233 |
CYP2C19-inhibitor: | 0.378 | CYP2C19-substrate: | 0.119 |
CYP2C9-inhibitor: | 0.231 | CYP2C9-substrate: | 0.923 |
CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.059 |
CYP3A4-inhibitor: | 0.336 | CYP3A4-substrate: | 0.07 |
Clearance (CL): | 7.469 | Half-life (T1/2): | 0.357 |
hERG Blockers: | 0.169 | Human Hepatotoxicity (H-HT): | 0.038 |
Drug-inuced Liver Injury (DILI): | 0.065 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.008 | Maximum Recommended Daily Dose: | 0.069 |
Skin Sensitization: | 0.957 | Carcinogencity: | 0.059 |
Eye Corrosion: | 0.905 | Eye Irritation: | 0.95 |
Respiratory Toxicity: | 0.66 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000972 | ![]() |
0.806 | D07ILQ | ![]() |
0.605 | ||
ENC001200 | ![]() |
0.771 | D0Z5SM | ![]() |
0.526 | ||
ENC000271 | ![]() |
0.758 | D00AOJ | ![]() |
0.500 | ||
ENC000496 | ![]() |
0.750 | D00FGR | ![]() |
0.489 | ||
ENC000280 | ![]() |
0.718 | D0O1PH | ![]() |
0.455 | ||
ENC002092 | ![]() |
0.716 | D05ATI | ![]() |
0.453 | ||
ENC000560 | ![]() |
0.712 | D0P1RL | ![]() |
0.430 | ||
ENC000781 | ![]() |
0.700 | D0T9TJ | ![]() |
0.404 | ||
ENC000497 | ![]() |
0.689 | D00MLW | ![]() |
0.364 | ||
ENC001377 | ![]() |
0.686 | D00STJ | ![]() |
0.354 |