|
Name |
Methyl nonadecanoate
|
| Molecular Formula | C20H40O2 | |
| IUPAC Name* |
methyl nonadecanoate
|
|
| SMILES |
CCCCCCCCCCCCCCCCCCC(=O)OC
|
|
| InChI |
InChI=1S/C20H40O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-2/h3-19H2,1-2H3
|
|
| InChIKey |
BDXAHSJUDUZLDU-UHFFFAOYSA-N
|
|
| Synonyms |
METHYL NONADECANOATE; 1731-94-8; Methyl nonadecan-1-oate; Nonadecanoic acid methyl ester; Nonadecanoic acid, methyl ester; methylnonadecanoate; n-Nonadecanoic acid methyl ester; Nonadecanoic acid-methyl ester; 67FQ8VV2L3; UNII-67FQ8VV2L3; EINECS 217-056-9; MFCD00009011; Nonadecanoic acid methyl; AI3-36454; Nonadecanoic acid,methyl ester; SCHEMBL109331; CHEBI:87758; DTXSID40169524; BAA73194; Methyl nonadecanoate, >=98% (GC); s5833; ZINC86046710; AKOS015903908; CS-W004262; HY-W004262; Methyl nonadecanoate, analytical standard; DB-043929; FT-0633802; N0460; H10860; Methyl nonadecanoate, puriss., >=98.5% (GC); J-010888; Q27159902; A25CCD7A-EA11-4124-B88C-A168A5582F47
|
|
| CAS | 1731-94-8 | |
| PubChem CID | 15610 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 312.5 | ALogp: | 9.5 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 22 | QED Weighted: | 0.219 |
| Caco-2 Permeability: | -4.91 | MDCK Permeability: | 0.00001260 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.965 |
| 30% Bioavailability (F30%): | 0.999 |
| Blood-Brain-Barrier Penetration (BBB): | 0.145 | Plasma Protein Binding (PPB): | 97.23% |
| Volume Distribution (VD): | 2.917 | Fu: | 1.36% |
| CYP1A2-inhibitor: | 0.233 | CYP1A2-substrate: | 0.189 |
| CYP2C19-inhibitor: | 0.337 | CYP2C19-substrate: | 0.065 |
| CYP2C9-inhibitor: | 0.12 | CYP2C9-substrate: | 0.952 |
| CYP2D6-inhibitor: | 0.235 | CYP2D6-substrate: | 0.046 |
| CYP3A4-inhibitor: | 0.313 | CYP3A4-substrate: | 0.045 |
| Clearance (CL): | 4.701 | Half-life (T1/2): | 0.171 |
| hERG Blockers: | 0.331 | Human Hepatotoxicity (H-HT): | 0.024 |
| Drug-inuced Liver Injury (DILI): | 0.401 | AMES Toxicity: | 0.006 |
| Rat Oral Acute Toxicity: | 0.02 | Maximum Recommended Daily Dose: | 0.016 |
| Skin Sensitization: | 0.962 | Carcinogencity: | 0.046 |
| Eye Corrosion: | 0.95 | Eye Irritation: | 0.958 |
| Respiratory Toxicity: | 0.899 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000474 | ![]() |
0.955 | D07ILQ | ![]() |
0.640 | ||
| ENC000280 | ![]() |
0.952 | D00AOJ | ![]() |
0.625 | ||
| ENC000496 | ![]() |
0.905 | D00FGR | ![]() |
0.551 | ||
| ENC000464 | ![]() |
0.875 | D0Z5SM | ![]() |
0.519 | ||
| ENC000271 | ![]() |
0.857 | D0O1PH | ![]() |
0.483 | ||
| ENC000258 | ![]() |
0.826 | D00STJ | ![]() |
0.451 | ||
| ENC000560 | ![]() |
0.810 | D05ATI | ![]() |
0.447 | ||
| ENC000724 | ![]() |
0.808 | D00MLW | ![]() |
0.413 | ||
| ENC000575 | ![]() |
0.783 | D0T9TJ | ![]() |
0.388 | ||
| ENC001181 | ![]() |
0.778 | D0P1RL | ![]() |
0.354 | ||