|
Name |
Methyl 2-hydroxyoctadecanoate
|
| Molecular Formula | C19H38O3 | |
| IUPAC Name* |
methyl 2-hydroxyoctadecanoate
|
|
| SMILES |
CCCCCCCCCCCCCCCCC(C(=O)OC)O
|
|
| InChI |
InChI=1S/C19H38O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(20)19(21)22-2/h18,20H,3-17H2,1-2H3
|
|
| InChIKey |
OUFCLLRNNJZLOX-UHFFFAOYSA-N
|
|
| Synonyms |
Methyl 2-hydroxyoctadecanoate; 2420-35-1; Methyl (+/-)-2-hydroxystearate; METHYL2-HYDROXYOCTADECANOATE; 1331-93-7; Methyl 2-hydroxystearate; Octadecanoic acid, 2-hydroxy-, methyl ester; SCHEMBL1277941; Methyl 2-hydroxyoctadecanoate #; Methyl DL-2-hydroxyoctadecanoate; 2-Hydroxystearic acid methyl ester; DTXSID601347938; FT-0729154; J-015396; Methyl (+/-)-2-hydroxystearate, >=98% (capillary GC); Octadecanoic acid, 2-hydroxy-, methyl ester, (.+/-.)-
|
|
| CAS | 2420-35-1 | |
| PubChem CID | 536367 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 314.5 | ALogp: | 7.8 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 17 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 0 |
| Heavy Atoms: | 22 | QED Weighted: | 0.297 |
| Caco-2 Permeability: | -4.782 | MDCK Permeability: | 0.00001520 |
| Pgp-inhibitor: | 0.051 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 1 |
| 30% Bioavailability (F30%): | 0.999 |
| Blood-Brain-Barrier Penetration (BBB): | 0.281 | Plasma Protein Binding (PPB): | 97.94% |
| Volume Distribution (VD): | 1.518 | Fu: | 1.56% |
| CYP1A2-inhibitor: | 0.17 | CYP1A2-substrate: | 0.303 |
| CYP2C19-inhibitor: | 0.246 | CYP2C19-substrate: | 0.089 |
| CYP2C9-inhibitor: | 0.13 | CYP2C9-substrate: | 0.902 |
| CYP2D6-inhibitor: | 0.023 | CYP2D6-substrate: | 0.07 |
| CYP3A4-inhibitor: | 0.124 | CYP3A4-substrate: | 0.038 |
| Clearance (CL): | 4.697 | Half-life (T1/2): | 0.597 |
| hERG Blockers: | 0.034 | Human Hepatotoxicity (H-HT): | 0.03 |
| Drug-inuced Liver Injury (DILI): | 0.049 | AMES Toxicity: | 0.042 |
| Rat Oral Acute Toxicity: | 0.047 | Maximum Recommended Daily Dose: | 0.054 |
| Skin Sensitization: | 0.919 | Carcinogencity: | 0.042 |
| Eye Corrosion: | 0.395 | Eye Irritation: | 0.948 |
| Respiratory Toxicity: | 0.778 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001217 | ![]() |
0.771 | D07ILQ | ![]() |
0.605 | ||
| ENC000496 | ![]() |
0.750 | D00AOJ | ![]() |
0.536 | ||
| ENC000280 | ![]() |
0.718 | D0Z5SM | ![]() |
0.526 | ||
| ENC001168 | ![]() |
0.718 | D00FGR | ![]() |
0.522 | ||
| ENC000488 | ![]() |
0.706 | D0O1PH | ![]() |
0.455 | ||
| ENC000271 | ![]() |
0.706 | D05ATI | ![]() |
0.453 | ||
| ENC000356 | ![]() |
0.706 | D0T9TJ | ![]() |
0.416 | ||
| ENC000424 | ![]() |
0.700 | D0P1RL | ![]() |
0.415 | ||
| ENC000781 | ![]() |
0.700 | D00STJ | ![]() |
0.375 | ||
| ENC000666 | ![]() |
0.694 | D00MLW | ![]() |
0.352 | ||