|
Name |
Methyl 3-hydroxytetradecanoate
|
| Molecular Formula | C15H30O3 | |
| IUPAC Name* |
methyl 3-hydroxytetradecanoate
|
|
| SMILES |
CCCCCCCCCCCC(CC(=O)OC)O
|
|
| InChI |
InChI=1S/C15H30O3/c1-3-4-5-6-7-8-9-10-11-12-14(16)13-15(17)18-2/h14,16H,3-13H2,1-2H3
|
|
| InChIKey |
UOZZAMWODZQSOA-UHFFFAOYSA-N
|
|
| Synonyms |
Methyl 3-hydroxytetradecanoate; 55682-83-2; 3-Hydroxy Myristic Acid Methyl Ester; 104871-97-8; METHYL (+/-)-3-HYDROXYMYRISTATE; Tetradecanoic acid, 3-hydroxy-, methyl ester; 3-Hydroxytetradecanoic acid methyl ester, DL-beta-Hydroxymyristic acid methyl ester; METHYL3-HYDROXYTETRADECANOATE; R-(3)-Hydroxymyristic acid, methyl ester; SCHEMBL2504944; DTXSID50971039; BCP33009; MFCD00211257; SY314471; Tetradecanoic acid,3-hydroxy-,methyl ester; DB-052771; CS-0453577; FT-0640328; FT-0669878; FT-0669880; (S)-Methyl 3-hydroxytetradecanoate;Methyl (S)-3-Hydroxytetradecanoate
|
|
| CAS | 55682-83-2 | |
| PubChem CID | 180523 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 258.4 | ALogp: | 5.0 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 13 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 0 |
| Heavy Atoms: | 18 | QED Weighted: | 0.414 |
| Caco-2 Permeability: | -4.621 | MDCK Permeability: | 0.00003000 |
| Pgp-inhibitor: | 0.533 | Pgp-substrate: | 0.571 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.986 |
| 30% Bioavailability (F30%): | 0.962 |
| Blood-Brain-Barrier Penetration (BBB): | 0.976 | Plasma Protein Binding (PPB): | 93.47% |
| Volume Distribution (VD): | 0.648 | Fu: | 4.15% |
| CYP1A2-inhibitor: | 0.86 | CYP1A2-substrate: | 0.603 |
| CYP2C19-inhibitor: | 0.497 | CYP2C19-substrate: | 0.429 |
| CYP2C9-inhibitor: | 0.391 | CYP2C9-substrate: | 0.867 |
| CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.077 |
| CYP3A4-inhibitor: | 0.213 | CYP3A4-substrate: | 0.111 |
| Clearance (CL): | 9.612 | Half-life (T1/2): | 0.625 |
| hERG Blockers: | 0.068 | Human Hepatotoxicity (H-HT): | 0.046 |
| Drug-inuced Liver Injury (DILI): | 0.057 | AMES Toxicity: | 0.009 |
| Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.082 |
| Skin Sensitization: | 0.944 | Carcinogencity: | 0.103 |
| Eye Corrosion: | 0.911 | Eye Irritation: | 0.956 |
| Respiratory Toxicity: | 0.327 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001217 | ![]() |
0.806 | D05ATI | ![]() |
0.492 | ||
| ENC001313 | ![]() |
0.786 | D07ILQ | ![]() |
0.447 | ||
| ENC001377 | ![]() |
0.738 | D0Z5SM | ![]() |
0.444 | ||
| ENC001612 | ![]() |
0.709 | D0O1PH | ![]() |
0.415 | ||
| ENC000260 | ![]() |
0.704 | D0P1RL | ![]() |
0.391 | ||
| ENC000495 | ![]() |
0.696 | D0XN8C | ![]() |
0.380 | ||
| ENC002092 | ![]() |
0.689 | D0G2KD | ![]() |
0.366 | ||
| ENC000604 | ![]() |
0.661 | D0D9NY | ![]() |
0.361 | ||
| ENC000549 | ![]() |
0.639 | D05QNO | ![]() |
0.361 | ||
| ENC000560 | ![]() |
0.629 | D00AOJ | ![]() |
0.360 | ||