|
Name |
Methyl 12-methyltetradecanoate
|
| Molecular Formula | C16H32O2 | |
| IUPAC Name* |
methyl 12-methyltetradecanoate
|
|
| SMILES |
CCC(C)CCCCCCCCCCC(=O)OC
|
|
| InChI |
InChI=1S/C16H32O2/c1-4-15(2)13-11-9-7-5-6-8-10-12-14-16(17)18-3/h15H,4-14H2,1-3H3
|
|
| InChIKey |
BJIUDNXPLSJWKE-UHFFFAOYSA-N
|
|
| Synonyms |
METHYL 12-METHYLTETRADECANOATE; 5129-66-8; Methyl 12-methylmyristate; 12-Methyltetradecanoic acid methyl ester; Tetradecanoic acid, 12-methyl-, methyl ester; METHYL12-METHYLTETRADECANOATE; SCHEMBL2499676; DTXSID20965581; methyl 12-methyl tetradeca-noate; Methyl tetradecanoate, 12-methyl; CHEBI:142658; 12-methylmyristic acid methyl ester; 2819F46C-BD79-404E-8476-D485872B5904
|
|
| CAS | 5129-66-8 | |
| PubChem CID | 21206 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 256.42 | ALogp: | 6.6 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 13 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 18 | QED Weighted: | 0.344 |
| Caco-2 Permeability: | -4.624 | MDCK Permeability: | 0.00001640 |
| Pgp-inhibitor: | 0.318 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.973 |
| 30% Bioavailability (F30%): | 0.975 |
| Blood-Brain-Barrier Penetration (BBB): | 0.466 | Plasma Protein Binding (PPB): | 96.99% |
| Volume Distribution (VD): | 1.126 | Fu: | 1.78% |
| CYP1A2-inhibitor: | 0.892 | CYP1A2-substrate: | 0.305 |
| CYP2C19-inhibitor: | 0.55 | CYP2C19-substrate: | 0.264 |
| CYP2C9-inhibitor: | 0.462 | CYP2C9-substrate: | 0.907 |
| CYP2D6-inhibitor: | 0.105 | CYP2D6-substrate: | 0.059 |
| CYP3A4-inhibitor: | 0.466 | CYP3A4-substrate: | 0.116 |
| Clearance (CL): | 6.319 | Half-life (T1/2): | 0.327 |
| hERG Blockers: | 0.086 | Human Hepatotoxicity (H-HT): | 0.036 |
| Drug-inuced Liver Injury (DILI): | 0.233 | AMES Toxicity: | 0.005 |
| Rat Oral Acute Toxicity: | 0.021 | Maximum Recommended Daily Dose: | 0.03 |
| Skin Sensitization: | 0.949 | Carcinogencity: | 0.077 |
| Eye Corrosion: | 0.941 | Eye Irritation: | 0.952 |
| Respiratory Toxicity: | 0.899 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001142 | ![]() |
0.893 | D0G2KD | ![]() |
0.436 | ||
| ENC001519 | ![]() |
0.786 | D05ATI | ![]() |
0.426 | ||
| ENC000551 | ![]() |
0.764 | D07ILQ | ![]() |
0.410 | ||
| ENC000548 | ![]() |
0.746 | D0P1RL | ![]() |
0.407 | ||
| ENC000260 | ![]() |
0.736 | D0Z5SM | ![]() |
0.387 | ||
| ENC000495 | ![]() |
0.727 | D0O1PH | ![]() |
0.381 | ||
| ENC001160 | ![]() |
0.710 | D05QNO | ![]() |
0.380 | ||
| ENC000604 | ![]() |
0.690 | D0Z5BC | ![]() |
0.365 | ||
| ENC001274 | ![]() |
0.685 | D09ANG | ![]() |
0.363 | ||
| ENC000848 | ![]() |
0.677 | D00MLW | ![]() |
0.354 | ||