![]() |
Name |
6-Hydroxymellein
|
Molecular Formula | C10H10O4 | |
IUPAC Name* |
(3R)-6,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one
|
|
SMILES |
C[C@@H]1CC2=C(C(=CC(=C2)O)O)C(=O)O1
|
|
InChI |
InChI=1S/C10H10O4/c1-5-2-6-3-7(11)4-8(12)9(6)10(13)14-5/h3-5,11-12H,2H2,1H3/t5-/m1/s1
|
|
InChIKey |
DHLPMLVSBRRUGA-RXMQYKEDSA-N
|
|
Synonyms |
6-Hydroxymellein; (R)-6-hydroxymellein; 70901-60-9; (-)-6-Hydroxymellein; 3,4-Dihydro-6,8-dihydroxy-3-methylisocoumarin; 6,8-Dihydroxy-3-methyl-3,4-dihydroisocoumarin; (R)-(-)-6-hydroxymellein; PUH8Z0Q805; (3R)-6,8-dihydroxy-3-methyl-3,4-dihydroisochromen-1-one; (3R)-3,4-dihydro-6,8-dihydroxy-3-methyl-isocoumarin; (3R)-6,8-dihydroxy-3-methyl-3,4-dihydro-1H-isochromen-1-one; (R)-3,4-dihydro-6,8-dihydroxy-3-methyl-1H-2-benzopyran-1-one; UNII-PUH8Z0Q805; MLS004257370; SCHEMBL638027; CHEBI:16368; DTXSID90991190; 6,8-dihydroxy-3-methyl-isochroman-1-one; SMR003082503; C02379; 6,8-Dihydroxy-3-methyl-3,4-dihydro-1H-2-benzopyran-1-one; 1H-2-Benzopyran-1-one, 3,4-dihydro-6,8-dihydroxy-3-methyl-, (R)-
|
|
CAS | 70901-60-9 | |
PubChem CID | 172675 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 194.18 | ALogp: | 2.1 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.616 |
Caco-2 Permeability: | -4.741 | MDCK Permeability: | 0.00001380 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.02 |
30% Bioavailability (F30%): | 0.898 |
Blood-Brain-Barrier Penetration (BBB): | 0.174 | Plasma Protein Binding (PPB): | 87.83% |
Volume Distribution (VD): | 0.832 | Fu: | 10.81% |
CYP1A2-inhibitor: | 0.964 | CYP1A2-substrate: | 0.228 |
CYP2C19-inhibitor: | 0.224 | CYP2C19-substrate: | 0.066 |
CYP2C9-inhibitor: | 0.268 | CYP2C9-substrate: | 0.865 |
CYP2D6-inhibitor: | 0.81 | CYP2D6-substrate: | 0.437 |
CYP3A4-inhibitor: | 0.466 | CYP3A4-substrate: | 0.13 |
Clearance (CL): | 14.48 | Half-life (T1/2): | 0.827 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.126 |
Drug-inuced Liver Injury (DILI): | 0.665 | AMES Toxicity: | 0.078 |
Rat Oral Acute Toxicity: | 0.054 | Maximum Recommended Daily Dose: | 0.781 |
Skin Sensitization: | 0.509 | Carcinogencity: | 0.492 |
Eye Corrosion: | 0.048 | Eye Irritation: | 0.933 |
Respiratory Toxicity: | 0.298 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005249 | ![]() |
1.000 | D07MGA | ![]() |
0.375 | ||
ENC000757 | ![]() |
0.681 | D07EXH | ![]() |
0.265 | ||
ENC002387 | ![]() |
0.681 | D04AIT | ![]() |
0.263 | ||
ENC005703 | ![]() |
0.625 | D0K8KX | ![]() |
0.256 | ||
ENC003871 | ![]() |
0.600 | D02NSF | ![]() |
0.250 | ||
ENC005553 | ![]() |
0.588 | D04JHN | ![]() |
0.241 | ||
ENC000856 | ![]() |
0.574 | D0H6QU | ![]() |
0.234 | ||
ENC005003 | ![]() |
0.567 | D07AHW | ![]() |
0.232 | ||
ENC003280 | ![]() |
0.565 | D0AZ8C | ![]() |
0.225 | ||
ENC002045 | ![]() |
0.560 | D0S5CH | ![]() |
0.221 |