|
Name |
(3R)-8-Hydroxy-3-methyl-3,4-dihydro-1H-2-benzopyran-1-one
|
| Molecular Formula | C10H10O3 | |
| IUPAC Name* |
(3R)-8-hydroxy-3-methyl-3,4-dihydroisochromen-1-one
|
|
| SMILES |
C[C@@H]1CC2=C(C(=CC=C2)O)C(=O)O1
|
|
| InChI |
InChI=1S/C10H10O3/c1-6-5-7-3-2-4-8(11)9(7)10(12)13-6/h2-4,6,11H,5H2,1H3/t6-/m1/s1
|
|
| InChIKey |
KWILGNNWGSNMPA-ZCFIWIBFSA-N
|
|
| Synonyms |
Mellein; 480-33-1; (3R)-8-Hydroxy-3-methyl-3,4-dihydro-1H-2-benzopyran-1-one; (-)-Mellein; (R)-mellein; (3R)-8-hydroxy-3-methyl-3,4-dihydroisochromen-1-one; Y30Y67M5SV; 1H-2-Benzopyran-1-one, 3,4-dihydro-8-hydroxy-3-methyl-, (3R)-; 1H-2-Benzopyran-1-one, 3,4-dihydro-8-hydroxy-3-methyl-, (R)-; (R)-(-)-Mellein; UNII-Y30Y67M5SV; (-)-(R)-MELLEIN; CHEMBL499303; SCHEMBL13925629; HY-N3300; ZINC4521655; BDBM50524013; AKOS025295360; CS-0023847; EN300-8234474; A937445; (3R)-8-HYDROXY-3-METHYL-ISOCHROMAN-1-ONE; 3,4-dihydro-8-hydroxy-3-methyl-(r)-1h-2-benzopyran-1-one; 8-Hydroxy-3-methyl-3,4-dihydro-1H-isochromen-1-one, (R)-; (R)-(-)-8-Hydroxy-3-methyl-3,4-dihydro-lH-2-benzopyran-l-one
|
|
| CAS | 480-33-1 | |
| PubChem CID | 114679 | |
| ChEMBL ID | CHEMBL499303 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 178.18 | ALogp: | 2.4 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 2 |
| Heavy Atoms: | 13 | QED Weighted: | 0.618 |
| Caco-2 Permeability: | -4.537 | MDCK Permeability: | 0.00002690 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.353 |
| Blood-Brain-Barrier Penetration (BBB): | 0.495 | Plasma Protein Binding (PPB): | 91.34% |
| Volume Distribution (VD): | 1.61 | Fu: | 7.15% |
| CYP1A2-inhibitor: | 0.965 | CYP1A2-substrate: | 0.277 |
| CYP2C19-inhibitor: | 0.601 | CYP2C19-substrate: | 0.184 |
| CYP2C9-inhibitor: | 0.38 | CYP2C9-substrate: | 0.863 |
| CYP2D6-inhibitor: | 0.7 | CYP2D6-substrate: | 0.566 |
| CYP3A4-inhibitor: | 0.295 | CYP3A4-substrate: | 0.157 |
| Clearance (CL): | 12.03 | Half-life (T1/2): | 0.591 |
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.14 |
| Drug-inuced Liver Injury (DILI): | 0.63 | AMES Toxicity: | 0.243 |
| Rat Oral Acute Toxicity: | 0.084 | Maximum Recommended Daily Dose: | 0.304 |
| Skin Sensitization: | 0.715 | Carcinogencity: | 0.932 |
| Eye Corrosion: | 0.146 | Eye Irritation: | 0.977 |
| Respiratory Toxicity: | 0.218 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000584 | ![]() |
1.000 | D0H6QU | ![]() |
0.310 | ||
| ENC002082 | ![]() |
1.000 | D07MGA | ![]() |
0.276 | ||
| ENC005942 | ![]() |
0.667 | D09OQV | ![]() |
0.266 | ||
| ENC001451 | ![]() |
0.667 | D04JHN | ![]() |
0.263 | ||
| ENC004821 | ![]() |
0.667 | D07HBX | ![]() |
0.260 | ||
| ENC005578 | ![]() |
0.667 | D02NSF | ![]() |
0.256 | ||
| ENC004829 | ![]() |
0.638 | D06BYV | ![]() |
0.250 | ||
| ENC003945 | ![]() |
0.638 | D0L1WV | ![]() |
0.250 | ||
| ENC005856 | ![]() |
0.636 | D0WE3O | ![]() |
0.247 | ||
| ENC002975 | ![]() |
0.636 | D0E9CD | ![]() |
0.245 | ||