NPs Basic Information
|
Name |
(3R)-5-oxo-de-O-methyllasiodiplodin
|
| Molecular Formula | C16H20O5 | |
| IUPAC Name* |
(4R)-14,16-dihydroxy-4-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-2,6-dione
|
|
| SMILES |
C[C@@H]1CC(=O)CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1
|
|
| InChI |
InChI=1S/C16H20O5/c1-10-7-12(17)6-4-2-3-5-11-8-13(18)9-14(19)15(11)16(20)21-10/h8-10,18-19H,2-7H2,1H3/t10-/m1/s1
|
|
| InChIKey |
KZOIYIPDPQANFM-SNVBAGLBSA-N
|
|
| Synonyms |
(3R)-5-oxo-de-O-methyllasiodiplodin
|
|
| CAS | NA | |
| PubChem CID | 139590426 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 292.33 | ALogp: | 3.2 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 83.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 21 | QED Weighted: | 0.715 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.777 | MDCK Permeability: | 0.00002850 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.008 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.813 |
| 30% Bioavailability (F30%): | 0.054 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.139 | Plasma Protein Binding (PPB): | 91.48% |
| Volume Distribution (VD): | 0.628 | Fu: | 8.79% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.954 | CYP1A2-substrate: | 0.255 |
| CYP2C19-inhibitor: | 0.742 | CYP2C19-substrate: | 0.061 |
| CYP2C9-inhibitor: | 0.698 | CYP2C9-substrate: | 0.955 |
| CYP2D6-inhibitor: | 0.883 | CYP2D6-substrate: | 0.497 |
| CYP3A4-inhibitor: | 0.577 | CYP3A4-substrate: | 0.115 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 13.293 | Half-life (T1/2): | 0.907 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.184 |
| Drug-inuced Liver Injury (DILI): | 0.55 | AMES Toxicity: | 0.058 |
| Rat Oral Acute Toxicity: | 0.087 | Maximum Recommended Daily Dose: | 0.737 |
| Skin Sensitization: | 0.514 | Carcinogencity: | 0.052 |
| Eye Corrosion: | 0.013 | Eye Irritation: | 0.672 |
| Respiratory Toxicity: | 0.298 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005002 |  |
0.813 | D07MGA |  |
0.308 | ||
| ENC005001 |  |
0.776 | D0P6VV |  |
0.267 | ||
| ENC003872 |  |
0.758 | D07GRH |  |
0.266 | ||
| ENC002297 |  |
0.701 | D00ZFP |  |
0.264 | ||
| ENC005003 |  |
0.701 | D02NSF |  |
0.263 | ||
| ENC005007 |  |
0.694 | D04JHN |  |
0.255 | ||
| ENC002701 |  |
0.681 | D03YVO |  |
0.245 | ||
| ENC001527 |  |
0.644 | D03WAJ |  |
0.241 | ||
| ENC003158 |  |
0.634 | D0PG8O |  |
0.240 | ||
| ENC003244 |  |
0.634 | D0H6QU |  |
0.237 | ||