|
Name |
6-Methoxymellein
|
| Molecular Formula | C11H12O4 | |
| IUPAC Name* |
(3R)-8-hydroxy-6-methoxy-3-methyl-3,4-dihydroisochromen-1-one
|
|
| SMILES |
C[C@@H]1CC2=C(C(=CC(=C2)OC)O)C(=O)O1
|
|
| InChI |
InChI=1S/C11H12O4/c1-6-3-7-4-8(14-2)5-9(12)10(7)11(13)15-6/h4-6,12H,3H2,1-2H3/t6-/m1/s1
|
|
| InChIKey |
AIFNAMVERSBWPS-ZCFIWIBFSA-N
|
|
| Synonyms |
6-Methoxymellein; 13410-15-6; (R)-6-methoxymellein; (R)-(-)-6-methoxymellein; CHEBI:2212; 424N0263W4; Isocoumarin, 3,4-dihydro-8-hydroxy-6-methoxy-3-methyl-, (R)-(-)-; (3R)-8-hydroxy-6-methoxy-3-methyl-3,4-dihydro-1H-isochromen-1-one; UNII-424N0263W4; (-)-6-Methoxymellein; (3R)-6-Methoxymellein; 8-Hydroxy-6-methoxy-3-methyl-3,4-dihydro-1H-isochromen-1-one #; CHEMBL449604; SCHEMBL2314134; DTXSID90928441; ZINC4095850; 1H-2-Benzopyran-1-one, 3,4-dihydro-8-hydroxy-6-methoxy-3-methyl-, (R)-; C02381
|
|
| CAS | 13410-15-6 | |
| PubChem CID | 83412 | |
| ChEMBL ID | CHEMBL449604 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 208.21 | ALogp: | 2.4 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 55.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 15 | QED Weighted: | 0.717 |
| Caco-2 Permeability: | -4.56 | MDCK Permeability: | 0.00002040 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.196 |
| Blood-Brain-Barrier Penetration (BBB): | 0.52 | Plasma Protein Binding (PPB): | 92.66% |
| Volume Distribution (VD): | 0.859 | Fu: | 5.66% |
| CYP1A2-inhibitor: | 0.975 | CYP1A2-substrate: | 0.85 |
| CYP2C19-inhibitor: | 0.625 | CYP2C19-substrate: | 0.37 |
| CYP2C9-inhibitor: | 0.385 | CYP2C9-substrate: | 0.903 |
| CYP2D6-inhibitor: | 0.807 | CYP2D6-substrate: | 0.803 |
| CYP3A4-inhibitor: | 0.471 | CYP3A4-substrate: | 0.15 |
| Clearance (CL): | 12.079 | Half-life (T1/2): | 0.5 |
| hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.217 |
| Drug-inuced Liver Injury (DILI): | 0.699 | AMES Toxicity: | 0.146 |
| Rat Oral Acute Toxicity: | 0.073 | Maximum Recommended Daily Dose: | 0.727 |
| Skin Sensitization: | 0.47 | Carcinogencity: | 0.665 |
| Eye Corrosion: | 0.036 | Eye Irritation: | 0.909 |
| Respiratory Toxicity: | 0.311 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005248 | ![]() |
0.681 | D07MGA | ![]() |
0.325 | ||
| ENC005249 | ![]() |
0.681 | D0S5CH | ![]() |
0.265 | ||
| ENC000960 | ![]() |
0.681 | D0L1JW | ![]() |
0.247 | ||
| ENC002387 | ![]() |
0.673 | D03SKD | ![]() |
0.247 | ||
| ENC003935 | ![]() |
0.615 | D0C1SF | ![]() |
0.247 | ||
| ENC005553 | ![]() |
0.615 | D0E9CD | ![]() |
0.246 | ||
| ENC005005 | ![]() |
0.587 | D0J4IX | ![]() |
0.241 | ||
| ENC002669 | ![]() |
0.585 | D0DJ1B | ![]() |
0.239 | ||
| ENC005763 | ![]() |
0.547 | D0X5KF | ![]() |
0.238 | ||
| ENC000584 | ![]() |
0.540 | D09PJX | ![]() |
0.235 | ||