![]() |
Name |
Benzene, 1-[2-(2-chloroethoxy)ethoxy]-4-(1,1,3,3-tetramethylbutyl)-
|
Molecular Formula | C18H29ClO2 | |
IUPAC Name* |
1-[2-(2-chloroethoxy)ethoxy]-4-(2,4,4-trimethylpentan-2-yl)benzene
|
|
SMILES |
CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCCCl
|
|
InChI |
InChI=1S/C18H29ClO2/c1-17(2,3)14-18(4,5)15-6-8-16(9-7-15)21-13-12-20-11-10-19/h6-9H,10-14H2,1-5H3
|
|
InChIKey |
FITQCDWGUKECBJ-UHFFFAOYSA-N
|
|
Synonyms |
65925-28-2; Benzene, 1-[2-(2-chloroethoxy)ethoxy]-4-(1,1,3,3-tetramethylbutyl)-; 1-(2-(2-Chloroethoxy)ethoxy)-4-(1,1,3,3-tetramethylbutyl)benzene; 1-[2-(2-Chloroethoxy)ethoxy]-4-(1,1,3,3-tetramethylbutyl)benzene; Benzene, 1-(2-(2-chloroethoxy)ethoxy)-4-(1,1,3,3-tetramethylbutyl)-; EINECS 265-982-7; DTXSID9070371; SCHEMBL15978997; AKOS012975430; 1-Chloro-5-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-3-oxapentane; 1-[2-(2-Chloroethoxy)ethoxy]-4-(1,1,3,3-tetramethylbutyl)benzene #
|
|
CAS | 65925-28-2 | |
PubChem CID | 105232 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 312.9 | ALogp: | 5.7 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 18.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 21 | QED Weighted: | 0.474 |
Caco-2 Permeability: | -4.616 | MDCK Permeability: | 0.00001510 |
Pgp-inhibitor: | 0.89 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.028 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.206 | Plasma Protein Binding (PPB): | 98.50% |
Volume Distribution (VD): | 1.619 | Fu: | 1.91% |
CYP1A2-inhibitor: | 0.27 | CYP1A2-substrate: | 0.451 |
CYP2C19-inhibitor: | 0.799 | CYP2C19-substrate: | 0.733 |
CYP2C9-inhibitor: | 0.61 | CYP2C9-substrate: | 0.829 |
CYP2D6-inhibitor: | 0.161 | CYP2D6-substrate: | 0.544 |
CYP3A4-inhibitor: | 0.449 | CYP3A4-substrate: | 0.313 |
Clearance (CL): | 10.102 | Half-life (T1/2): | 0.137 |
hERG Blockers: | 0.142 | Human Hepatotoxicity (H-HT): | 0.205 |
Drug-inuced Liver Injury (DILI): | 0.031 | AMES Toxicity: | 0.31 |
Rat Oral Acute Toxicity: | 0.131 | Maximum Recommended Daily Dose: | 0.162 |
Skin Sensitization: | 0.294 | Carcinogencity: | 0.557 |
Eye Corrosion: | 0.284 | Eye Irritation: | 0.95 |
Respiratory Toxicity: | 0.908 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001175 | ![]() |
0.536 | D00NJL | ![]() |
0.375 | ||
ENC000309 | ![]() |
0.524 | D0K3ZR | ![]() |
0.330 | ||
ENC000152 | ![]() |
0.328 | D0J5DC | ![]() |
0.299 | ||
ENC001358 | ![]() |
0.307 | D0I2MK | ![]() |
0.294 | ||
ENC000898 | ![]() |
0.292 | D02HXS | ![]() |
0.291 | ||
ENC003401 | ![]() |
0.289 | D06YPU | ![]() |
0.280 | ||
ENC000744 | ![]() |
0.284 | D03ROX | ![]() |
0.280 | ||
ENC000185 | ![]() |
0.284 | D0A6CQ | ![]() |
0.280 | ||
ENC005113 | ![]() |
0.284 | D0V4UF | ![]() |
0.280 | ||
ENC005263 | ![]() |
0.280 | D0QC3M | ![]() |
0.277 |