![]() |
Name |
4-tert-Octylphenol
|
Molecular Formula | C14H22O | |
IUPAC Name* |
4-(2,4,4-trimethylpentan-2-yl)phenol
|
|
SMILES |
CC(C)(C)CC(C)(C)C1=CC=C(C=C1)O
|
|
InChI |
InChI=1S/C14H22O/c1-13(2,3)10-14(4,5)11-6-8-12(15)9-7-11/h6-9,15H,10H2,1-5H3
|
|
InChIKey |
ISAVYTVYFVQUDY-UHFFFAOYSA-N
|
|
Synonyms |
4-tert-Octylphenol; 140-66-9; 4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOL; 4-(2,4,4-trimethylpentan-2-yl)phenol; p-tert-Octylphenol; 4-t-Octylphenol; Phenol, 4-(1,1,3,3-tetramethylbutyl)-; p-Terc.oktylfenol; para-tert-Octylphenol; p-(1,1,3,3-Tetramethylbutyl)phenol; Phenol, p-(tert-octyl)-; p-Octylphenol (VAN); P-T-Octylphenol; Phenol, p-(1,1,3,3-tetramethylbutyl)-; tert-Octylphenol, flaked; IOY9FVU3J3; 4-(TERT-OCTYL)PHENOL; CHEMBL259327; CHEBI:34445; NSC-5427; NSC-7248; MFCD00002368; NCGC00164127-02; NCGC00164127-03; p-(1',1',3',3'-Tetramethylbutyl)phenol; DSSTox_CID_2360; DSSTox_RID_76556; DSSTox_GSID_22360; p-(1,3,3-Tetramethylbutyl)phenol; 4-(1,3,3-Tetramethylbutyl)phenol; p-terc.Oktylfenol [Czech]; p-(1',3',3'-Tetramethylbutyl)phenol; CAS-140-66-9; HSDB 5411; NSC 5427; EINECS 205-426-2; UNII-IOY9FVU3J3; WLN: QR DX1 & 1 & 1X1 & 1 & 1; BRN 0513992; Octylphenol pt; AI3-10011; CCRIS 8947; p-(1',1',3',3'-Tetramethylbutyl)fenol; 4mga; 27L; p-tert.-octylphenol; 4-tert-octyl-phenol; 4-tert.-octylphenol; p-(1,1,3,3-tetramethylbutyl)-phenol; 4-(1,1,3,3-TetraMethyl-Butyl)Phenol; p-(Tert-octyl)-Phenol; para-tert.-octyl phenol; p-Terc.oktylfenol(Czech); EC 205-426-2; 4-tert-Octylphenol, 97%; SCHEMBL10141; 4-06-00-03484 (Beilstein Handbook Reference); BIDD:ER0044; OCTYLPHENOL, 4-TERT-; DTXSID9022360; NSC5427; NSC7248; HY-B1941; ZINC1686938; Tox21_112084; Tox21_400011; BBL027379; BDBM50423506; STK594853; AKOS005516422; Tox21_112084_1; CCG-275197; 4-(1,1,3,3-tetramethylbutyl)-phenol; 4-tert-Octylphenol, analytical standard; NCGC00164127-01; NCGC00164127-04; NCGC00164127-05; NCGC00164127-06; NCGC00164127-07; NCGC00181157-01; 4-(1,1,3,3-tetramethyl-butyl)-phenol; VS-08533; DB-063344; Phenol, p- (1,1,3,3-tetramethylbutyl)-; CS-0013994; FT-0616437; FT-0673243; p-(1',1',3', 3'-Tetramethylbutyl)phenol; Phenol, 4- (1,1,3,3-tetramethylbutyl)-; T0144; EN300-20811; E77202; 4-(2,4,4-TRIMETHYL-2-PENTANYL)PHENOL; SR-01000944308; J-523827; SR-01000944308-2; W-108198; 4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOL [HSDB]; BRD-K64273664-001-01-6; Q15632771; 4-(1,1,3,3-Tetramethylbutyl)phenol (ACD/Name 4.0); Z104483006; 4-tert-Octylphenol, certified reference material, TraceCERT(R)
|
|
CAS | 140-66-9 | |
PubChem CID | 8814 | |
ChEMBL ID | CHEMBL259327 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 206.32 | ALogp: | 5.0 |
HBD: | 1 | HBA: | 1 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.743 |
Caco-2 Permeability: | -4.653 | MDCK Permeability: | 0.00001470 |
Pgp-inhibitor: | 0.316 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.191 | 20% Bioavailability (F20%): | 0.602 |
30% Bioavailability (F30%): | 0.018 |
Blood-Brain-Barrier Penetration (BBB): | 0.406 | Plasma Protein Binding (PPB): | 93.74% |
Volume Distribution (VD): | 5.164 | Fu: | 9.30% |
CYP1A2-inhibitor: | 0.389 | CYP1A2-substrate: | 0.748 |
CYP2C19-inhibitor: | 0.88 | CYP2C19-substrate: | 0.843 |
CYP2C9-inhibitor: | 0.548 | CYP2C9-substrate: | 0.956 |
CYP2D6-inhibitor: | 0.55 | CYP2D6-substrate: | 0.864 |
CYP3A4-inhibitor: | 0.12 | CYP3A4-substrate: | 0.269 |
Clearance (CL): | 8.285 | Half-life (T1/2): | 0.28 |
hERG Blockers: | 0.035 | Human Hepatotoxicity (H-HT): | 0.029 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.195 | Maximum Recommended Daily Dose: | 0.047 |
Skin Sensitization: | 0.718 | Carcinogencity: | 0.051 |
Eye Corrosion: | 0.978 | Eye Irritation: | 0.984 |
Respiratory Toxicity: | 0.475 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000152 | ![]() |
0.651 | D00NJL | ![]() |
0.471 | ||
ENC001175 | ![]() |
0.600 | D06YPU | ![]() |
0.393 | ||
ENC000838 | ![]() |
0.524 | D0B3QM | ![]() |
0.357 | ||
ENC000744 | ![]() |
0.426 | D03UOT | ![]() |
0.356 | ||
ENC000185 | ![]() |
0.426 | D0W1RY | ![]() |
0.346 | ||
ENC005113 | ![]() |
0.426 | D0U5QK | ![]() |
0.327 | ||
ENC000898 | ![]() |
0.389 | D0QC3M | ![]() |
0.308 | ||
ENC000394 | ![]() |
0.388 | D02LTL | ![]() |
0.303 | ||
ENC000086 | ![]() |
0.386 | D01CRB | ![]() |
0.298 | ||
ENC000695 | ![]() |
0.375 | D02WAB | ![]() |
0.288 |