|
Name |
1,1-Diethoxypropane
|
| Molecular Formula | C7H16O2 | |
| IUPAC Name* |
1,1-diethoxypropane
|
|
| SMILES |
CCC(OCC)OCC
|
|
| InChI |
InChI=1S/C7H16O2/c1-4-7(8-5-2)9-6-3/h7H,4-6H2,1-3H3
|
|
| InChIKey |
MBNMGGKBGCIEGF-UHFFFAOYSA-N
|
|
| Synonyms |
Propionaldehyde diethyl acetal; 1,1-DIETHOXYPROPANE; 4744-08-5; Propane, 1,1-diethoxy-; Propionaldehyde, diethyl acetal; Propanaldiethylacetal; Propanal diethyl acetal; Diethyl propional; PROPIONALDEHYDEDIETHYLACETAL; propionaldehyde diethylacetal; 944H8XF5QD; NSC-227930; Propane,1-diethoxy-; 1,1-diethoxy-propane; propioaldehyde diethylacetal; Propioaldehyde diethyl acetal; UNII-944H8XF5QD; SCHEMBL25094; propion-aldehyde-diethyl-acetal; DTXSID8063593; propaNALDEHYDE DIETHYL ACETAL; ZINC388448; EINECS 225-257-8; MFCD00009245; NSC227930; Propionaldehyde diethyl acetal, 97%; AKOS028108400; NSC 227930; DB-051450; P0781; EN300-80058; D97857; Q63409602
|
|
| CAS | 4744-08-5 | |
| PubChem CID | 20858 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 132.2 | ALogp: | 1.7 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 18.5 | Aromatic Rings: | 0 |
| Heavy Atoms: | 9 | QED Weighted: | 0.535 |
| Caco-2 Permeability: | -4.044 | MDCK Permeability: | 0.00004030 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.01 |
| 30% Bioavailability (F30%): | 0.012 |
| Blood-Brain-Barrier Penetration (BBB): | 0.61 | Plasma Protein Binding (PPB): | 24.46% |
| Volume Distribution (VD): | 1.744 | Fu: | 57.81% |
| CYP1A2-inhibitor: | 0.049 | CYP1A2-substrate: | 0.81 |
| CYP2C19-inhibitor: | 0.05 | CYP2C19-substrate: | 0.868 |
| CYP2C9-inhibitor: | 0.011 | CYP2C9-substrate: | 0.164 |
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.226 |
| CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.273 |
| Clearance (CL): | 12.483 | Half-life (T1/2): | 0.611 |
| hERG Blockers: | 0.05 | Human Hepatotoxicity (H-HT): | 0.025 |
| Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.009 |
| Rat Oral Acute Toxicity: | 0.01 | Maximum Recommended Daily Dose: | 0.011 |
| Skin Sensitization: | 0.097 | Carcinogencity: | 0.266 |
| Eye Corrosion: | 0.264 | Eye Irritation: | 0.972 |
| Respiratory Toxicity: | 0.02 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000569 | ![]() |
0.583 | D0U8AT | ![]() |
0.231 | ||
| ENC000182 | ![]() |
0.300 | D0ZK8H | ![]() |
0.222 | ||
| ENC001045 | ![]() |
0.282 | D0K3LW | ![]() |
0.213 | ||
| ENC001212 | ![]() |
0.282 | D0S1ZB | ![]() |
0.213 | ||
| ENC001232 | ![]() |
0.268 | D02KBD | ![]() |
0.204 | ||
| ENC000833 | ![]() |
0.262 | D0O5NK | ![]() |
0.203 | ||
| ENC000561 | ![]() |
0.256 | D0Y3KG | ![]() |
0.190 | ||
| ENC000226 | ![]() |
0.250 | D08QME | ![]() |
0.170 | ||
| ENC000768 | ![]() |
0.250 | D0A4JK | ![]() |
0.167 | ||
| ENC000903 | ![]() |
0.250 | D0G7DJ | ![]() |
0.164 | ||