|
Name |
Methyl 2-ethylhexanoate
|
| Molecular Formula | C9H18O2 | |
| IUPAC Name* |
methyl 2-ethylhexanoate
|
|
| SMILES |
CCCCC(CC)C(=O)OC
|
|
| InChI |
InChI=1S/C9H18O2/c1-4-6-7-8(5-2)9(10)11-3/h8H,4-7H2,1-3H3
|
|
| InChIKey |
KICUISADAVMYCJ-UHFFFAOYSA-N
|
|
| Synonyms |
Methyl 2-ethylhexanoate; 816-19-3; Hexanoic acid, 2-ethyl-, methyl ester; Hexanoic acid,2-ethyl-, methyl ester; 2-Ethylhexanoic Acid Methyl Ester; CHEMBL1762665; 2-Ethyl-methyl ester hexanoic acid; Methyl-2-Butyl-Butyrate; 3100891M19; EINECS 212-429-2; UNII-3100891M19; methyl 2 ethylhexanoate; AI3-33653; EC 212-429-2; SCHEMBL49923; 2-Ethylhexanoic acid methylester; DTXSID9052559; KICUISADAVMYCJ-UHFFFAOYSA-; BDBM50340083; Methyl ester of 2-ethylhexanoic acid; MFCD00043849; AKOS009513282; AS-76678; D93232; EN300-170600; Q27255986
|
|
| CAS | 816-19-3 | |
| PubChem CID | 102491 | |
| ChEMBL ID | CHEMBL1762665 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 158.24 | ALogp: | 3.0 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 11 | QED Weighted: | 0.574 |
| Caco-2 Permeability: | -4.299 | MDCK Permeability: | 0.00002750 |
| Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.005 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.712 |
| 30% Bioavailability (F30%): | 0.909 |
| Blood-Brain-Barrier Penetration (BBB): | 0.996 | Plasma Protein Binding (PPB): | 37.12% |
| Volume Distribution (VD): | 1.081 | Fu: | 62.79% |
| CYP1A2-inhibitor: | 0.915 | CYP1A2-substrate: | 0.923 |
| CYP2C19-inhibitor: | 0.582 | CYP2C19-substrate: | 0.886 |
| CYP2C9-inhibitor: | 0.238 | CYP2C9-substrate: | 0.578 |
| CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.349 |
| CYP3A4-inhibitor: | 0.081 | CYP3A4-substrate: | 0.315 |
| Clearance (CL): | 8.568 | Half-life (T1/2): | 0.625 |
| hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.066 |
| Drug-inuced Liver Injury (DILI): | 0.05 | AMES Toxicity: | 0.011 |
| Rat Oral Acute Toxicity: | 0.052 | Maximum Recommended Daily Dose: | 0.027 |
| Skin Sensitization: | 0.649 | Carcinogencity: | 0.133 |
| Eye Corrosion: | 0.912 | Eye Irritation: | 0.974 |
| Respiratory Toxicity: | 0.847 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000652 | ![]() |
0.649 | D0Y3KG | ![]() |
0.375 | ||
| ENC000306 | ![]() |
0.618 | D0ZK8H | ![]() |
0.289 | ||
| ENC002444 | ![]() |
0.525 | D01QLH | ![]() |
0.275 | ||
| ENC000211 | ![]() |
0.488 | D07CNL | ![]() |
0.269 | ||
| ENC000849 | ![]() |
0.447 | D0X4FM | ![]() |
0.253 | ||
| ENC000235 | ![]() |
0.432 | D03LGY | ![]() |
0.242 | ||
| ENC000570 | ![]() |
0.422 | D0K3LW | ![]() |
0.234 | ||
| ENC000212 | ![]() |
0.422 | D0CT4D | ![]() |
0.232 | ||
| ENC000726 | ![]() |
0.415 | D02KBD | ![]() |
0.228 | ||
| ENC000903 | ![]() |
0.410 | D0ZI4H | ![]() |
0.227 | ||