|
Name |
Ethyl 3-hydroxypentanoate
|
| Molecular Formula | C7H14O3 | |
| IUPAC Name* |
ethyl 3-hydroxypentanoate
|
|
| SMILES |
CCC(CC(=O)OCC)O
|
|
| InChI |
InChI=1S/C7H14O3/c1-3-6(8)5-7(9)10-4-2/h6,8H,3-5H2,1-2H3
|
|
| InChIKey |
YESYELHMPYCIAQ-UHFFFAOYSA-N
|
|
| Synonyms |
Ethyl 3-hydroxypentanoate; 54074-85-0; Pentanoic acid, 3-hydroxy-, ethyl ester; 3-hydroxypentanoic acid ethyl ester; Ethyl3-hydroxypentanoate; ethyl 3-hydroxypentanate; Ethyl 3-hydroxypentanoate #; ETHYL 3-HYDROXYVALERATE; SCHEMBL1427228; DTXSID40311809; 3-Hydroxyvaleric acid ethyl ester; NSC245481; AKOS011683141; pentanoic acid,3-hydroxy-,ethyl ester; NSC-245481; DS-012140; D96332; EN300-224740; PENTANOIC ACID,3-HYDROXY-, ETHYL ESTER
|
|
| CAS | 54074-85-0 | |
| PubChem CID | 316884 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 146.18 | ALogp: | 0.7 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 0 |
| Heavy Atoms: | 10 | QED Weighted: | 0.604 |
| Caco-2 Permeability: | -4.29 | MDCK Permeability: | 0.00032679 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.079 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.087 |
| Blood-Brain-Barrier Penetration (BBB): | 0.9 | Plasma Protein Binding (PPB): | 11.78% |
| Volume Distribution (VD): | 0.765 | Fu: | 75.92% |
| CYP1A2-inhibitor: | 0.26 | CYP1A2-substrate: | 0.313 |
| CYP2C19-inhibitor: | 0.082 | CYP2C19-substrate: | 0.83 |
| CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.155 |
| CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.16 |
| CYP3A4-inhibitor: | 0.011 | CYP3A4-substrate: | 0.368 |
| Clearance (CL): | 11.28 | Half-life (T1/2): | 0.883 |
| hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.026 |
| Drug-inuced Liver Injury (DILI): | 0.04 | AMES Toxicity: | 0.036 |
| Rat Oral Acute Toxicity: | 0.012 | Maximum Recommended Daily Dose: | 0.073 |
| Skin Sensitization: | 0.308 | Carcinogencity: | 0.131 |
| Eye Corrosion: | 0.907 | Eye Irritation: | 0.979 |
| Respiratory Toxicity: | 0.079 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000241 | ![]() |
0.531 | D0K3LW | ![]() |
0.333 | ||
| ENC000224 | ![]() |
0.517 | D0Y3KG | ![]() |
0.300 | ||
| ENC000226 | ![]() |
0.516 | D0G8SQ | ![]() |
0.293 | ||
| ENC000371 | ![]() |
0.471 | D0ZK8H | ![]() |
0.278 | ||
| ENC001313 | ![]() |
0.434 | D09CIQ | ![]() |
0.266 | ||
| ENC001015 | ![]() |
0.410 | D00WUF | ![]() |
0.256 | ||
| ENC005382 | ![]() |
0.380 | D02KBD | ![]() |
0.241 | ||
| ENC000758 | ![]() |
0.375 | D02CKX | ![]() |
0.234 | ||
| ENC000312 | ![]() |
0.367 | D0O5NK | ![]() |
0.232 | ||
| ENC001138 | ![]() |
0.361 | D0G2KD | ![]() |
0.222 | ||