|
Name |
Orcinol
|
| Molecular Formula | C7H8O2 | |
| IUPAC Name* |
5-methylbenzene-1,3-diol
|
|
| SMILES |
CC1=CC(=CC(=C1)O)O
|
|
| InChI |
InChI=1S/C7H8O2/c1-5-2-6(8)4-7(9)3-5/h2-4,8-9H,1H3
|
|
| InChIKey |
OIPPWFOQEKKFEE-UHFFFAOYSA-N
|
|
| Synonyms |
Orcinol; 3,5-Dihydroxytoluene; 504-15-4; 5-methylbenzene-1,3-diol; 5-METHYLRESORCINOL; 1,3-Dihydroxy-5-methylbenzene; Orcin; 5-Methyl-1,3-benzenediol; 5-Methylresorcin; 1,3-Benzenediol, 5-methyl-; 3-Hydroxy-5-methylphenol; 3,5-Toluenediol; Resorcinol, 5-methyl-; Orcinol, 5-methylresorcinol; 5-Methyl Resorcinol; Oricinol; MFCD00002291; NSC 12441; 5-Methyl-1,3-dihydroxybenzene; CHEBI:16536; 3,5-Dihydroxy-toluene; 5-Methyl-benzene-1,3-diol; NSC-12441; 534PMB3438; EINECS 207-984-2; 5-Methylresorcinol anhydrous; BRN 1071903; Orcine; AI3-23954; UNII-534PMB3438; 5-methyl-resorcinol; resorcinol monohydrate; 3,5-ToluenediolOrcin; Orcinol, 97%; ORCINOL [MI]; 5-methylbenzen-1,3-diol; WLN: QR CQ E1; SCHEMBL68497; 4-06-00-05892 (Beilstein Handbook Reference); 5-Methylresorcinol, anhydrous; CHEMBL110059; DTXSID2060123; 5-methylbenzene-1,3-diol;Orcinol; ZINC391826; HY-D0168; NSC12441; BBL027377; BDBM50104667; c0155; s9329; STL146540; AKOS000280922; 1,5-DIHYDROXY-3-METHYLBENZENE; CCG-266088; CS-W008652; SC10142; AC-10290; AS-14515; SY002780; DB-022064; FT-0620669; M0426; M1235; EN300-67390; C00727; H11838; O-2990; 153D395; 504M154; A828110; Q412476; F0001-1314; Z1079442080
|
|
| CAS | 504-15-4 | |
| PubChem CID | 10436 | |
| ChEMBL ID | CHEMBL110059 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 124.14 | ALogp: | 1.6 |
| HBD: | 2 | HBA: | 2 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 40.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 9 | QED Weighted: | 0.554 |
| Caco-2 Permeability: | -4.578 | MDCK Permeability: | 0.00001410 |
| Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.655 |
| Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.97 |
| 30% Bioavailability (F30%): | 0.937 |
| Blood-Brain-Barrier Penetration (BBB): | 0.056 | Plasma Protein Binding (PPB): | 57.04% |
| Volume Distribution (VD): | 0.775 | Fu: | 38.86% |
| CYP1A2-inhibitor: | 0.883 | CYP1A2-substrate: | 0.731 |
| CYP2C19-inhibitor: | 0.153 | CYP2C19-substrate: | 0.087 |
| CYP2C9-inhibitor: | 0.049 | CYP2C9-substrate: | 0.925 |
| CYP2D6-inhibitor: | 0.394 | CYP2D6-substrate: | 0.782 |
| CYP3A4-inhibitor: | 0.199 | CYP3A4-substrate: | 0.166 |
| Clearance (CL): | 15.676 | Half-life (T1/2): | 0.908 |
| hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.18 |
| Drug-inuced Liver Injury (DILI): | 0.038 | AMES Toxicity: | 0.017 |
| Rat Oral Acute Toxicity: | 0.619 | Maximum Recommended Daily Dose: | 0.689 |
| Skin Sensitization: | 0.927 | Carcinogencity: | 0.057 |
| Eye Corrosion: | 0.978 | Eye Irritation: | 0.99 |
| Respiratory Toxicity: | 0.244 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003023 | ![]() |
0.600 | D07EXH | ![]() |
0.600 | ||
| ENC003024 | ![]() |
0.514 | D02UFG | ![]() |
0.422 | ||
| ENC005631 | ![]() |
0.514 | D0M8RC | ![]() |
0.404 | ||
| ENC002445 | ![]() |
0.479 | D03UOT | ![]() |
0.314 | ||
| ENC005580 | ![]() |
0.426 | D06GIP | ![]() |
0.293 | ||
| ENC000329 | ![]() |
0.412 | D04XEG | ![]() |
0.288 | ||
| ENC003305 | ![]() |
0.400 | D0T7OW | ![]() |
0.256 | ||
| ENC004713 | ![]() |
0.393 | D04PHC | ![]() |
0.255 | ||
| ENC005214 | ![]() |
0.392 | D07MOX | ![]() |
0.244 | ||
| ENC004676 | ![]() |
0.378 | D04EYC | ![]() |
0.244 | ||