|
Name |
3-methyl-6,8-dihydroxyisocoumarin
|
| Molecular Formula | C10H8O4 | |
| IUPAC Name* |
6,8-dihydroxy-3-methylisochromen-1-one
|
|
| SMILES |
Cc1cc2cc(O)cc(O)c2c(=O)o1
|
|
| InChI |
InChI=1S/C10H8O4/c1-5-2-6-3-7(11)4-8(12)9(6)10(13)14-5/h2-4,11-12H,1H3
|
|
| InChIKey |
OHHKDUWFPNAEHQ-UHFFFAOYSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 192.17 | ALogp: | 1.5 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 70.7 | Aromatic Rings: | 2 |
| Heavy Atoms: | 14 | QED Weighted: | 0.67 |
| Caco-2 Permeability: | -4.76 | MDCK Permeability: | 0.00001120 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.992 |
| Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.801 |
| 30% Bioavailability (F30%): | 0.997 |
| Blood-Brain-Barrier Penetration (BBB): | 0.063 | Plasma Protein Binding (PPB): | 87.28% |
| Volume Distribution (VD): | 0.627 | Fu: | 15.61% |
| CYP1A2-inhibitor: | 0.972 | CYP1A2-substrate: | 0.808 |
| CYP2C19-inhibitor: | 0.179 | CYP2C19-substrate: | 0.063 |
| CYP2C9-inhibitor: | 0.291 | CYP2C9-substrate: | 0.93 |
| CYP2D6-inhibitor: | 0.451 | CYP2D6-substrate: | 0.609 |
| CYP3A4-inhibitor: | 0.144 | CYP3A4-substrate: | 0.141 |
| Clearance (CL): | 9.641 | Half-life (T1/2): | 0.828 |
| hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.098 |
| Drug-inuced Liver Injury (DILI): | 0.85 | AMES Toxicity: | 0.095 |
| Rat Oral Acute Toxicity: | 0.097 | Maximum Recommended Daily Dose: | 0.796 |
| Skin Sensitization: | 0.894 | Carcinogencity: | 0.053 |
| Eye Corrosion: | 0.821 | Eye Irritation: | 0.977 |
| Respiratory Toxicity: | 0.304 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001542 | ![]() |
1.000 | D04AIT | ![]() |
0.371 | ||
| ENC005370 | ![]() |
1.000 | D0K8KX | ![]() |
0.361 | ||
| ENC001951 | ![]() |
0.681 | D0FA2O | ![]() |
0.349 | ||
| ENC002113 | ![]() |
0.681 | D07MGA | ![]() |
0.320 | ||
| ENC006014 | ![]() |
0.681 | D07EXH | ![]() |
0.319 | ||
| ENC002933 | ![]() |
0.653 | D06GCK | ![]() |
0.274 | ||
| ENC001569 | ![]() |
0.647 | D0G4KG | ![]() |
0.264 | ||
| ENC004556 | ![]() |
0.647 | D0Y7PG | ![]() |
0.260 | ||
| ENC005110 | ![]() |
0.623 | D02UFG | ![]() |
0.258 | ||
| ENC005393 | ![]() |
0.579 | D0M8RC | ![]() |
0.250 | ||