![]() |
Name |
licanorin
|
Molecular Formula | C15H14O5 | |
IUPAC Name* |
(3-hydroxy-5-methylphenyl)2,4-dihydroxy-6-methylbenzoate
|
|
SMILES |
Cc1cc(O)cc(OC(=O)c2c(C)cc(O)cc2O)c1
|
|
InChI |
InChI=1S/C15H14O5/c1-8-3-10(16)6-12(4-8)20-15(19)14-9(2)5-11(17)7-13(14)18/h3-7,16-18H,1-2H3
|
|
InChIKey |
LRMGCIMCOOHPQA-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 274.27 | ALogp: | 2.6 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.577 |
Caco-2 Permeability: | -5.069 | MDCK Permeability: | 0.00001380 |
Pgp-inhibitor: | 0.025 | Pgp-substrate: | 0.025 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.985 |
30% Bioavailability (F30%): | 0.777 |
Blood-Brain-Barrier Penetration (BBB): | 0.07 | Plasma Protein Binding (PPB): | 97.64% |
Volume Distribution (VD): | 0.48 | Fu: | 1.95% |
CYP1A2-inhibitor: | 0.97 | CYP1A2-substrate: | 0.682 |
CYP2C19-inhibitor: | 0.607 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.626 | CYP2C9-substrate: | 0.905 |
CYP2D6-inhibitor: | 0.839 | CYP2D6-substrate: | 0.644 |
CYP3A4-inhibitor: | 0.693 | CYP3A4-substrate: | 0.128 |
Clearance (CL): | 14.004 | Half-life (T1/2): | 0.909 |
hERG Blockers: | 0.033 | Human Hepatotoxicity (H-HT): | 0.032 |
Drug-inuced Liver Injury (DILI): | 0.316 | AMES Toxicity: | 0.135 |
Rat Oral Acute Toxicity: | 0.349 | Maximum Recommended Daily Dose: | 0.942 |
Skin Sensitization: | 0.943 | Carcinogencity: | 0.036 |
Eye Corrosion: | 0.235 | Eye Irritation: | 0.977 |
Respiratory Toxicity: | 0.596 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003724 | ![]() |
0.719 | D07EXH | ![]() |
0.322 | ||
ENC003748 | ![]() |
0.667 | D07MGA | ![]() |
0.322 | ||
ENC002944 | ![]() |
0.657 | D04AIT | ![]() |
0.318 | ||
ENC005402 | ![]() |
0.636 | D0K8KX | ![]() |
0.295 | ||
ENC003732 | ![]() |
0.556 | D0Y7PG | ![]() |
0.286 | ||
ENC002591 | ![]() |
0.549 | D0H2ZW | ![]() |
0.278 | ||
ENC002965 | ![]() |
0.547 | D02UFG | ![]() |
0.270 | ||
ENC004163 | ![]() |
0.545 | D04XEG | ![]() |
0.264 | ||
ENC002445 | ![]() |
0.530 | D0M8RC | ![]() |
0.263 | ||
ENC003317 | ![]() |
0.526 | D0S6JG | ![]() |
0.261 |