|
Name |
Cumene
|
| Molecular Formula | C9H12 | |
| IUPAC Name* |
cumene
|
|
| SMILES |
CC(C)C1=CC=CC=C1
|
|
| InChI |
InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3
|
|
| InChIKey |
RWGFKTVRMDUZSP-UHFFFAOYSA-N
|
|
| Synonyms |
CUMENE; Isopropylbenzene; 98-82-8; 2-Phenylpropane; (1-Methylethyl)benzene; Benzene, (1-methylethyl)-; Cumol; Isopropylbenzol; Cumeen; Isopropilbenzene; Isopropylbenzeen; 2-Fenilpropano; 2-Fenyl-propaan; Isopropyl-benzol; (propan-2-yl)benzene; Benzene, isopropyl; Propan-2-ylbenzene; Propane, 2-phenyl; i-propylbenzene; RCRA waste number U055; (Methylethyl)benzene; Isopropylbenzen; isopropyl-benzene; NSC 8776; 4-isopropylbenzene; Benzene, isopropyl-; Propane, 2-phenyl-; 68333-89-1; 8Q54S3XE7K; (1-methylethyl)benzene (cumene); CHEBI:34656; NSC-8776; Cumeen [Dutch]; 101316-43-2; Phenol bottoms; Isopropylbenzeen [Dutch]; 2-Fenilpropano [Italian]; 2-Fenyl-propaan [Dutch]; Isopropyl-benzol [German]; Isopropilbenzene [Italian]; HSDB 172; ISOPROPYL BENZENE; Benzene, 1-methylethyl-; EINECS 202-704-5; MFCD00008881; UN1918; RCRA waste no. U055; cumen; UNII-8Q54S3XE7K; AI3-04630; CCRIS 9455; 2-phenyl-propane; I-Propyl-Benzene; 4-isopropyl benzene; Benzene, i-propyl-; Propane-2-yl-benzene; 1-Methylethyl-Benzene; Benzene,isopropyl cumol; Cumene, 98%; Isopropyl-benzol(german); (1-methylethyl)-benzene; CUMENE [HSDB]; CUMENE [IARC]; CUMENE [USP-RS]; CUMENE [MI]; DSSTox_CID_1827; Iso-propylbenzene (cumene); 1-Methylethylbenzene, 9CI; Cumene, analytical standard; EC 202-704-5; Isopropylbenzene [UN1918] [Flammable liquid]; DSSTox_RID_76352; DSSTox_GSID_21827; 68411-37-0; CUMENE (CUMENE HYDROPEROXIDE (80-15-9)); MLS002454396; BIDD:ER0700; CHEMBL1398949; DTXSID1021827; ISOPROPYLBENZENE (CUMENE); BENZENE,ISOPROPYL CUMOL; NSC8776; WLN: 1Y1 & R; HMS3039J15; ZINC1648223; Tox21_202503; STL282733; AKOS000269066; UN 1918; CAS-98-82-8; NCGC00091155-01; NCGC00260052-01; SMR001372007; Cumene, PESTANAL(R), analytical standard; Isopropylbenzene 10 microg/mL in Methanol; Isopropylbenzene 100 microg/mL in Methanol; FT-0624111; S0652; EN300-19973; Isopropylbenzene [UN1918] [Flammable liquid]; A858512; Q410107; J-520110; J-660071; F0001-2320; Cumene, United States Pharmacopeia (USP) Reference Standard; Cumene, Pharmaceutical Secondary Standard; Certified Reference Material; 68936-98-1
|
|
| CAS | 98-82-8 | |
| PubChem CID | 7406 | |
| ChEMBL ID | CHEMBL1398949 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 120.19 | ALogp: | 3.7 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 9 | QED Weighted: | 0.531 |
| Caco-2 Permeability: | -4.158 | MDCK Permeability: | 0.00002280 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.012 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.649 |
| 30% Bioavailability (F30%): | 0.536 |
| Blood-Brain-Barrier Penetration (BBB): | 0.695 | Plasma Protein Binding (PPB): | 93.62% |
| Volume Distribution (VD): | 2.341 | Fu: | 7.43% |
| CYP1A2-inhibitor: | 0.963 | CYP1A2-substrate: | 0.874 |
| CYP2C19-inhibitor: | 0.69 | CYP2C19-substrate: | 0.758 |
| CYP2C9-inhibitor: | 0.382 | CYP2C9-substrate: | 0.203 |
| CYP2D6-inhibitor: | 0.34 | CYP2D6-substrate: | 0.159 |
| CYP3A4-inhibitor: | 0.024 | CYP3A4-substrate: | 0.372 |
| Clearance (CL): | 7.197 | Half-life (T1/2): | 0.431 |
| hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.031 |
| Drug-inuced Liver Injury (DILI): | 0.14 | AMES Toxicity: | 0.017 |
| Rat Oral Acute Toxicity: | 0.088 | Maximum Recommended Daily Dose: | 0.026 |
| Skin Sensitization: | 0.218 | Carcinogencity: | 0.378 |
| Eye Corrosion: | 0.971 | Eye Irritation: | 0.995 |
| Respiratory Toxicity: | 0.046 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001960 | ![]() |
0.571 | D00HHS | ![]() |
0.568 | ||
| ENC001934 | ![]() |
0.571 | D0LG8E | ![]() |
0.568 | ||
| ENC000654 | ![]() |
0.556 | D0P6UB | ![]() |
0.474 | ||
| ENC000173 | ![]() |
0.514 | D05BMG | ![]() |
0.472 | ||
| ENC000064 | ![]() |
0.500 | D0T3LF | ![]() |
0.472 | ||
| ENC000365 | ![]() |
0.486 | D05OIS | ![]() |
0.412 | ||
| ENC000368 | ![]() |
0.486 | D0U0RZ | ![]() |
0.410 | ||
| ENC000207 | ![]() |
0.455 | D06IXT | ![]() |
0.392 | ||
| ENC000203 | ![]() |
0.455 | D0S2UG | ![]() |
0.391 | ||
| ENC000214 | ![]() |
0.452 | D0X9RY | ![]() |
0.389 | ||