![]() |
Name |
(1S,2R)-1-Phenyl-1,2-propanediol
|
Molecular Formula | C9H12O2 | |
IUPAC Name* |
(1S,2R)-1-phenylpropane-1,2-diol
|
|
SMILES |
C[C@H]([C@H](C1=CC=CC=C1)O)O
|
|
InChI |
InChI=1S/C9H12O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9-11H,1H3/t7-,9-/m1/s1
|
|
InChIKey |
MZQZXSHFWDHNOW-VXNVDRBHSA-N
|
|
Synonyms |
erythro-1-Phenylpropane-1,2-diol; SCHEMBL6483432; (S,r)-1-phenyl-1,2-propanediol; ZINC2039193; (1S,2R)-1-Phenyl-1,2-propanediol
|
|
CAS | NA | |
PubChem CID | 9898882 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 152.19 | ALogp: | 1.1 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.675 |
Caco-2 Permeability: | -4.586 | MDCK Permeability: | 0.00001740 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.053 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.282 |
30% Bioavailability (F30%): | 0.697 |
Blood-Brain-Barrier Penetration (BBB): | 0.386 | Plasma Protein Binding (PPB): | 48.22% |
Volume Distribution (VD): | 1.713 | Fu: | 47.74% |
CYP1A2-inhibitor: | 0.206 | CYP1A2-substrate: | 0.555 |
CYP2C19-inhibitor: | 0.046 | CYP2C19-substrate: | 0.375 |
CYP2C9-inhibitor: | 0.019 | CYP2C9-substrate: | 0.345 |
CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.288 |
CYP3A4-inhibitor: | 0.005 | CYP3A4-substrate: | 0.357 |
Clearance (CL): | 6.711 | Half-life (T1/2): | 0.729 |
hERG Blockers: | 0.028 | Human Hepatotoxicity (H-HT): | 0.031 |
Drug-inuced Liver Injury (DILI): | 0.13 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.065 | Maximum Recommended Daily Dose: | 0.008 |
Skin Sensitization: | 0.077 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.914 |
Respiratory Toxicity: | 0.017 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001960 | ![]() |
1.000 | D00HHS | ![]() |
0.658 | ||
ENC000191 | ![]() |
0.571 | D0LG8E | ![]() |
0.658 | ||
ENC000173 | ![]() |
0.568 | D05BMG | ![]() |
0.415 | ||
ENC001033 | ![]() |
0.467 | D0T3LF | ![]() |
0.415 | ||
ENC000654 | ![]() |
0.452 | D04EYC | ![]() |
0.409 | ||
ENC000064 | ![]() |
0.429 | D05OIS | ![]() |
0.395 | ||
ENC000052 | ![]() |
0.429 | D0P6UB | ![]() |
0.386 | ||
ENC001005 | ![]() |
0.419 | D0X9RY | ![]() |
0.341 | ||
ENC004714 | ![]() |
0.400 | D0R1CR | ![]() |
0.340 | ||
ENC003112 | ![]() |
0.400 | D0U0RZ | ![]() |
0.333 |