![]() |
Name |
1-Phenyl-1,2-ethanediol
|
Molecular Formula | C8H10O2 | |
IUPAC Name* |
1-phenylethane-1,2-diol
|
|
SMILES |
C1=CC=C(C=C1)C(CO)O
|
|
InChI |
InChI=1S/C8H10O2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8-10H,6H2
|
|
InChIKey |
PWMWNFMRSKOCEY-UHFFFAOYSA-N
|
|
Synonyms |
1-Phenyl-1,2-ethanediol; 93-56-1; 1-phenylethane-1,2-diol; STYRENE GLYCOL; Phenylethylene glycol; 1,2-Ethanediol, 1-phenyl-; Phenylethanediol; Phenyl glycol; Phenyl-1,2-ethanediol; Styrolyl alcohol; 1-Phenylethylene glycol; Phenylethane-1,2-diol; 1,2-Dihydroxy-1-phenylethane; Fenylglycol; 1,2-Dihydroxyethylbenzene; 1,2-Ethanediol, phenyl-; 1-Fenyl-1,2-ethandiol; NSC 406601; (+/-)-1-Phenyl-1,2-ethanediol; .alpha.,.beta.-Dihydroxyethylbenzene; 2ZAC511UK8; NSC-406601; 7138-28-5; Fenylglycol [Czech]; Phenyl glycol ether; alpha,beta-Dihydroxyethylbenzene; 1-Fenyl-1,2-ethandiol [Czech]; EINECS 202-258-1; BRN 1306723; UNII-2ZAC511UK8; AI3-03789; MFCD00064262; MFCD00066256; MFCD00003546; 1-phenyl-1; (+/-)-Styrene glycol; rac Styrene Glycol-[d8]; 2-phenyl-2-hydroxyethanol; 1-phenyl-ethane-1,2-diol; DSSTox_CID_22422; DSSTox_RID_80019; NCIOpen2_003573; STYRENE GLYCOL [MI]; DSSTox_GSID_42422; SCHEMBL24750; 4-06-00-05939 (Beilstein Handbook Reference); CHEMBL3188703; DTXSID8042422; (+)-1-phenyl-1,2-ethanediol; alpha-(hydroxymethyl)benzylalcohol; CHEBI:183269; 1-Phenyl-1,2-ethanediol, 97%; alpha-(hydroxymethyl)benzyl alcohol; N2-METHYL-2-DEOXYGUANOSINE; STYRENE GLYCOL, (+/-)-; Tox21_302040; NSC406601; 1,2-DIHYDROXY-2-PHENYLETHANE; AKOS004903345; CS-W016504; FD10472; HY-W015788; SB44462; SB44621; CAS-93-56-1; NCGC00255814-01; AS-11660; SY017542; SY017543; DB-011656; DB-057411; FT-0604449; FT-0605073; FT-0605276; FT-0674673; P0686; EN300-111545; A844633; Q26841299
|
|
CAS | 93-56-1 | |
PubChem CID | 7149 | |
ChEMBL ID | CHEMBL3188703 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 138.16 | ALogp: | 0.4 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.643 |
Caco-2 Permeability: | -4.6 | MDCK Permeability: | 0.00014246 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.128 | 20% Bioavailability (F20%): | 0.686 |
30% Bioavailability (F30%): | 0.868 |
Blood-Brain-Barrier Penetration (BBB): | 0.664 | Plasma Protein Binding (PPB): | 28.79% |
Volume Distribution (VD): | 1.228 | Fu: | 67.14% |
CYP1A2-inhibitor: | 0.113 | CYP1A2-substrate: | 0.193 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.317 |
CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.126 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.312 |
CYP3A4-inhibitor: | 0.005 | CYP3A4-substrate: | 0.296 |
Clearance (CL): | 7.155 | Half-life (T1/2): | 0.733 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.035 |
Drug-inuced Liver Injury (DILI): | 0.058 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.092 | Maximum Recommended Daily Dose: | 0.017 |
Skin Sensitization: | 0.198 | Carcinogencity: | 0.037 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.952 |
Respiratory Toxicity: | 0.019 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001934 | ![]() |
0.568 | D05OIS | ![]() |
0.500 | ||
ENC001960 | ![]() |
0.568 | D0LG8E | ![]() |
0.488 | ||
ENC001033 | ![]() |
0.561 | D00HHS | ![]() |
0.488 | ||
ENC001005 | ![]() |
0.553 | D0T3LF | ![]() |
0.400 | ||
ENC000191 | ![]() |
0.514 | D05BMG | ![]() |
0.400 | ||
ENC000014 | ![]() |
0.500 | D0R1CR | ![]() |
0.386 | ||
ENC001493 | ![]() |
0.487 | D0X5WJ | ![]() |
0.375 | ||
ENC002666 | ![]() |
0.487 | D0P6UB | ![]() |
0.372 | ||
ENC000128 | ![]() |
0.459 | D0X9RY | ![]() |
0.359 | ||
ENC000845 | ![]() |
0.457 | D0P9AC | ![]() |
0.357 |