|
Name |
Acetyl tributyl citrate
|
| Molecular Formula | C20H34O8 | |
| IUPAC Name* |
tributyl 2-acetyloxypropane-1,2,3-tricarboxylate
|
|
| SMILES |
CCCCOC(=O)CC(CC(=O)OCCCC)(C(=O)OCCCC)OC(=O)C
|
|
| InChI |
InChI=1S/C20H34O8/c1-5-8-11-25-17(22)14-20(28-16(4)21,19(24)27-13-10-7-3)15-18(23)26-12-9-6-2/h5-15H2,1-4H3
|
|
| InChIKey |
QZCLKYGREBVARF-UHFFFAOYSA-N
|
|
| Synonyms |
77-90-7; ACETYL TRIBUTYL CITRATE; tributyl 2-acetoxypropane-1,2,3-tricarboxylate; Acetyltributyl citrate; Tributyl acetylcitrate; Tributyl O-acetylcitrate; Citroflex A; Blo-trol; Citroflex A 4; 2-Acetyltributylcitrate; Tributyl citrate acetate; ATBC; 1,2,3-Propanetricarboxylic acid, 2-(acetyloxy)-, tributyl ester; Tributyl acetyl citrate; FEMA No. 3080; acetyltributylcitrate; Acetylcitric acid, tributyl ester; Tributyl acetylicitrate; Citric acid, tributyl ester, acetate; o-Acetylcitric acid tributyl ester; Acetyl tri-n-butyl citrate; NSC 3894; Uniplex 84; Tributyl 2-acetoxy-1,2,3-propanetricarboxylate; Acetyl butyl citrate; tributyl 2-acetyloxypropane-1,2,3-tricarboxylate; Tributyl 2-(acetyloxy)-1,2,3-propanetricarboxylate; 2-Acetoxy-1,2,3-propanetricarboxylic acid tributyl ester; NSC-3894; 0ZBX0N59RZ; 1,2,3-Propanetricarboxylic acid, 2-(acetyloxy)-, 1,2,3-tributyl ester; DSSTox_CID_6446; DSSTox_RID_78115; DSSTox_GSID_26446; Tributyl 2-(acetyloxy)-1,2,3-propanetricarboxylic acid; 1,2,3-Propanetricarboxylic acid, 2-acetoxy-, tributyl ester; Caswell No. 005AB; MFCD00043554; CAS-77-90-7; CCRIS 3409; HSDB 656; EINECS 201-067-0; UNII-0ZBX0N59RZ; Acetyltributyl citrate [NF]; BRN 2303316; Estaflex; AI3-01999; Estaflex ATC; Pfizer citroflex A-4; Acetylcitric acid tributyl; EC 201-067-0; SCHEMBL23183; Tributyl O-acetylcitrate, 98%; CHEMBL1904556; DTXSID2026446; Acetyl Tributyl Citrate (ATBC); FEMA 3080; NSC3894; CHEBI:168067; Citric acid, acetyl tributyl ester; ACETYLTRIBUTYL CITRATE [II]; 2-(Acetyloxy)-1,2,3-propanetricarboxylic acid, tributyl ester; ZINC3875493; Tox21_112777; Tox21_201779; Tox21_303128; ACETYLTRIBUTYL CITRATE [HSDB]; TRIBUTYL ACETYLCITRATE [FHFI]; ACETYL TRIBUTYL CITRATE [INCI]; AKOS015895884; TRIBUTYL ACETYLCITRATE [MART.]; ACETYLTRIBUTYL CITRATE [USP-RS]; CS-W011697; Tributyl 2-acetylcitrate, >=98%, FG; NCGC00164157-01; NCGC00164157-02; NCGC00257221-01; NCGC00259328-01; BS-18149; NCI60_003698; CITRIC ACID, O-ACETYLTRIBUTYL ESTER; A0822; Citric acid, tributyl ester, acetate (8CI); FT-0621820; Tributyl 2-acetoxy-1,3-propanetricarboxylate; TRIBUTYL ACETYLCITRATE [EP MONOGRAPH]; D70155; Tributyl 2-acetoxy-1,2, 3-propanetricarboxylate; A839285; SR-01000883988; Q4673294; SR-01000883988-1; Tributyl 2-(acetyloxy)-1,3-propanetricarboxylic acid; 2-Acetoxy-1,3-propanetricarboxylic acid tributyl ester; Tributyl 2-(acetyloxy)-1,2, 3-propanetricarboxylic acid; 1,2,3-tributyl 2-(acetyloxy)propane-1,2,3-tricarboxylate; 2-Acetoxy-1,2, 3-propanetricarboxylic acid tributyl ester; 1,3-Propanetricarboxylic acid, 2-(acetyloxy)-, tributyl ester; 2-(Acetyloxy)-1,2,3-propane tricarboxylic acid, tributyl ester; 2-ACETYLOXY-1,2,3-PROPANETRICARBOXYLIC ACID TRIBUTYL ESTER; Acetyltributyl citrate, United States Pharmacopeia (USP) Reference Standard; Tributyl acetylcitrate, European Pharmacopoeia (EP) Reference Standard; Tributyl 2-acetylcitrate, Pharmaceutical Secondary Standard; Certified Reference Material
|
|
| CAS | 77-90-7 | |
| PubChem CID | 6505 | |
| ChEMBL ID | CHEMBL1904556 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 402.5 | ALogp: | 3.3 |
| HBD: | 0 | HBA: | 8 |
| Rotatable Bonds: | 19 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 105.0 | Aromatic Rings: | 0 |
| Heavy Atoms: | 28 | QED Weighted: | 0.231 |
| Caco-2 Permeability: | -4.6 | MDCK Permeability: | 0.00003480 |
| Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.991 |
| 30% Bioavailability (F30%): | 0.997 |
| Blood-Brain-Barrier Penetration (BBB): | 0.722 | Plasma Protein Binding (PPB): | 80.78% |
| Volume Distribution (VD): | 0.451 | Fu: | 16.50% |
| CYP1A2-inhibitor: | 0.877 | CYP1A2-substrate: | 0.08 |
| CYP2C19-inhibitor: | 0.862 | CYP2C19-substrate: | 0.126 |
| CYP2C9-inhibitor: | 0.867 | CYP2C9-substrate: | 0.087 |
| CYP2D6-inhibitor: | 0.152 | CYP2D6-substrate: | 0.037 |
| CYP3A4-inhibitor: | 0.447 | CYP3A4-substrate: | 0.317 |
| Clearance (CL): | 6.732 | Half-life (T1/2): | 0.633 |
| hERG Blockers: | 0.125 | Human Hepatotoxicity (H-HT): | 0.034 |
| Drug-inuced Liver Injury (DILI): | 0.806 | AMES Toxicity: | 0.014 |
| Rat Oral Acute Toxicity: | 0.104 | Maximum Recommended Daily Dose: | 0.013 |
| Skin Sensitization: | 0.166 | Carcinogencity: | 0.102 |
| Eye Corrosion: | 0.865 | Eye Irritation: | 0.6 |
| Respiratory Toxicity: | 0.02 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000158 | ![]() |
0.388 | D00MLW | ![]() |
0.356 | ||
| ENC000601 | ![]() |
0.364 | D0X4FM | ![]() |
0.325 | ||
| ENC000742 | ![]() |
0.341 | D0AY9Q | ![]() |
0.297 | ||
| ENC000669 | ![]() |
0.333 | D0UF9W | ![]() |
0.257 | ||
| ENC000213 | ![]() |
0.333 | D0Q7ZQ | ![]() |
0.255 | ||
| ENC000655 | ![]() |
0.329 | D06ORU | ![]() |
0.243 | ||
| ENC000164 | ![]() |
0.327 | D0Z1QC | ![]() |
0.242 | ||
| ENC000090 | ![]() |
0.320 | D0K8CI | ![]() |
0.239 | ||
| ENC003079 | ![]() |
0.320 | D0L2UN | ![]() |
0.234 | ||
| ENC003057 | ![]() |
0.302 | D0K2TB | ![]() |
0.233 | ||