![]() |
Name |
Butoxycarbonylmethyl butyl phthalate
|
Molecular Formula | C18H24O6 | |
IUPAC Name* |
2-O-(2-butoxy-2-oxoethyl) 1-O-butyl benzene-1,2-dicarboxylate
|
|
SMILES |
CCCCOC(=O)COC(=O)C1=CC=CC=C1C(=O)OCCCC
|
|
InChI |
InChI=1S/C18H24O6/c1-3-5-11-22-16(19)13-24-18(21)15-10-8-7-9-14(15)17(20)23-12-6-4-2/h7-10H,3-6,11-13H2,1-2H3
|
|
InChIKey |
GOJCZVPJCKEBQV-UHFFFAOYSA-N
|
|
Synonyms |
85-70-1; Butyl phthalyl butyl glycolate; Butoxycarbonylmethyl butyl phthalate; Reomol 4pg; Butyl carbobutoxymethyl phthalate; Butyl glycolyl butyl phthalate; 2-butoxy-2-oxoethyl butyl phthalate; Butyl phthalate butyl glycolate; Butylphthalyl butylglycolate; Dibutyl o-carboxybenzoyloxyacetate; 2-O-(2-butoxy-2-oxoethyl) 1-O-butyl benzene-1,2-dicarboxylate; Glycolic acid, butyl ester, butyl phthalate; Phthalic acid, butyl ester, ester with butyl glycolate; Santicizer B 16; Dibutyl O-(o-carboxybenzoyl) glycolate; Glycolic acid, phthalate, dibutyl ester; Morflex 190; 1,2-Benzenedicarboxylic acid, 2-butoxy-2-oxoethyl butyl ester; BUTYLPHTHALYLBUTYLGLYCOLATE; Phthalic acid, butyl ester, butyl glycolate; Phthalic acid, butoxycarbonylmethyl butyl ester; I5LOD5H050; 1,2-Benzenedicarboxylic acid, 2-butoxy-2-oxoethyl, butyl ester; 1,2-Benzenedicarboxylic acid, 1-(2-butoxy-2-oxoethyl) 2-butyl ester; DSSTox_CID_3938; Phthalic acid, 2-butoxy-2-oxoethyl butyl ester; DSSTox_RID_77237; DSSTox_GSID_23938; Santicizer B-16; phthalic acid butoxycarbonylmethyl ester butyl ester; Caswell No. 131B; CAS-85-70-1; Butylcarbobutoxymethyl phthalate; HSDB 284; AI3-01793 (USDA); EINECS 201-624-8; Dibutyl O-(o-carboxybenzoyl)glycolate; BRN 2007363; UNII-I5LOD5H050; AI3-01793; BUTYLPHTHALYL BUTYL GLYCOLATE; Butylphthalyl butylglycolate (BPBG); MORFLEX-190; butyl phthalyl butylglycolate; SCHEMBL3500556; CHEMBL3182027; DTXSID7023938; CHEBI:191079; n-Butyl phthalyl n-butyl glycoate; n-Butyl phthalyl-n-butyl glycolate; ZINC3875591; Tox21_202314; Tox21_303276; MFCD00053793; AKOS015838980; NCGC00249208-01; NCGC00257134-01; NCGC00259863-01; BUTYL 2-BUTOXY-2-EXOETHYL PHTHALATE; B0737; BUTYL GLYCOLYL BUTYL PHTHALATE [HSDB]; BUTYL PHTHALYL BUTYL GLYCOLATE [INCI]; CS-0206549; Phthalic Acid Butoxycarbonylmethyl Butyl Ester; 1-(2-Butoxy-2-oxoethyl) 2-butyl phthalate #; E78985; Q27280474; 1,2-BENZENEDICARBOXYLIC ACID (BUTOXYCARBONYLMETHYL) BUTYL ESTER
|
|
CAS | 85-70-1 | |
PubChem CID | 6819 | |
ChEMBL ID | CHEMBL3182027 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 336.4 | ALogp: | 4.6 |
HBD: | 0 | HBA: | 6 |
Rotatable Bonds: | 13 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 78.9 | Aromatic Rings: | 1 |
Heavy Atoms: | 24 | QED Weighted: | 0.366 |
Caco-2 Permeability: | -4.563 | MDCK Permeability: | 0.00003340 |
Pgp-inhibitor: | 0.914 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.995 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.065 | Plasma Protein Binding (PPB): | 91.13% |
Volume Distribution (VD): | 0.497 | Fu: | 4.10% |
CYP1A2-inhibitor: | 0.979 | CYP1A2-substrate: | 0.184 |
CYP2C19-inhibitor: | 0.945 | CYP2C19-substrate: | 0.064 |
CYP2C9-inhibitor: | 0.897 | CYP2C9-substrate: | 0.143 |
CYP2D6-inhibitor: | 0.497 | CYP2D6-substrate: | 0.079 |
CYP3A4-inhibitor: | 0.55 | CYP3A4-substrate: | 0.128 |
Clearance (CL): | 13.57 | Half-life (T1/2): | 0.688 |
hERG Blockers: | 0.146 | Human Hepatotoxicity (H-HT): | 0.008 |
Drug-inuced Liver Injury (DILI): | 0.728 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.002 | Maximum Recommended Daily Dose: | 0.004 |
Skin Sensitization: | 0.844 | Carcinogencity: | 0.128 |
Eye Corrosion: | 0.615 | Eye Irritation: | 0.979 |
Respiratory Toxicity: | 0.016 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000090 | ![]() |
0.809 | D06ORU | ![]() |
0.358 | ||
ENC000669 | ![]() |
0.688 | D0K8CI | ![]() |
0.336 | ||
ENC000157 | ![]() |
0.654 | D0H2SY | ![]() |
0.333 | ||
ENC000164 | ![]() |
0.640 | D0N6CR | ![]() |
0.316 | ||
ENC000300 | ![]() |
0.625 | D0P5GE | ![]() |
0.314 | ||
ENC000586 | ![]() |
0.605 | D0E9WO | ![]() |
0.301 | ||
ENC000291 | ![]() |
0.581 | D0AY9Q | ![]() |
0.298 | ||
ENC001801 | ![]() |
0.576 | D05PHH | ![]() |
0.297 | ||
ENC000156 | ![]() |
0.545 | D08HQK | ![]() |
0.290 | ||
ENC000301 | ![]() |
0.542 | D0Q7ZG | ![]() |
0.289 |