|
Name |
Butyl decyl phthalate
|
| Molecular Formula | C22H34O4 | |
| IUPAC Name* |
1-O-butyl 2-O-decyl benzene-1,2-dicarboxylate
|
|
| SMILES |
CCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC
|
|
| InChI |
InChI=1S/C22H34O4/c1-3-5-7-8-9-10-11-14-18-26-22(24)20-16-13-12-15-19(20)21(23)25-17-6-4-2/h12-13,15-16H,3-11,14,17-18H2,1-2H3
|
|
| InChIKey |
NJMAFLHPUNGKOD-UHFFFAOYSA-N
|
|
| Synonyms |
BUTYL DECYL PHTHALATE; 89-19-0; Plasticizer BDP; Decyl butyl phthalate; 1,2-Benzenedicarboxylic acid, butyl decyl ester; Phthalic acid, butyl decyl ester; PX 114; 1-O-butyl 2-O-decyl benzene-1,2-dicarboxylate; B1O5S7879S; 1,2-Benzenedicarboxylicacid, 1-butyl 2-decyl ester; NSC-16200; EINECS 201-885-8; NSC 16200; BRN 1999817; UNII-B1O5S7879S; 1, butyl decyl ester; Butyl-n-decyl phthalate; WLN: 10OVR BVO4; SCHEMBL151839; 1-Butyl 2-decyl phthalate #; DTXSID7052600; NSC16200; PX-114; ZINC95703909; Phthalic acid, n-butyl-n-decyl ester; AKOS028108441; Q27274257
|
|
| CAS | 89-19-0 | |
| PubChem CID | 6963 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 362.5 | ALogp: | 8.0 |
| HBD: | 0 | HBA: | 4 |
| Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 52.6 | Aromatic Rings: | 1 |
| Heavy Atoms: | 26 | QED Weighted: | 0.3 |
| Caco-2 Permeability: | -4.752 | MDCK Permeability: | 0.00002040 |
| Pgp-inhibitor: | 0.963 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 1 |
| 30% Bioavailability (F30%): | 0.997 |
| Blood-Brain-Barrier Penetration (BBB): | 0.022 | Plasma Protein Binding (PPB): | 98.18% |
| Volume Distribution (VD): | 1.686 | Fu: | 1.52% |
| CYP1A2-inhibitor: | 0.403 | CYP1A2-substrate: | 0.193 |
| CYP2C19-inhibitor: | 0.688 | CYP2C19-substrate: | 0.054 |
| CYP2C9-inhibitor: | 0.255 | CYP2C9-substrate: | 0.775 |
| CYP2D6-inhibitor: | 0.549 | CYP2D6-substrate: | 0.059 |
| CYP3A4-inhibitor: | 0.484 | CYP3A4-substrate: | 0.064 |
| Clearance (CL): | 9.194 | Half-life (T1/2): | 0.085 |
| hERG Blockers: | 0.236 | Human Hepatotoxicity (H-HT): | 0.003 |
| Drug-inuced Liver Injury (DILI): | 0.275 | AMES Toxicity: | 0.005 |
| Rat Oral Acute Toxicity: | 0.002 | Maximum Recommended Daily Dose: | 0.005 |
| Skin Sensitization: | 0.938 | Carcinogencity: | 0.262 |
| Eye Corrosion: | 0.033 | Eye Irritation: | 0.987 |
| Respiratory Toxicity: | 0.047 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000669 | ![]() |
0.919 | D0K8CI | ![]() |
0.450 | ||
| ENC000291 | ![]() |
0.901 | D05ATI | ![]() |
0.391 | ||
| ENC000156 | ![]() |
0.839 | D0Z5SM | ![]() |
0.376 | ||
| ENC000090 | ![]() |
0.733 | D06ORU | ![]() |
0.374 | ||
| ENC001801 | ![]() |
0.699 | D0OR6A | ![]() |
0.372 | ||
| ENC000293 | ![]() |
0.658 | D00MLW | ![]() |
0.362 | ||
| ENC000158 | ![]() |
0.640 | D0G2KD | ![]() |
0.347 | ||
| ENC000616 | ![]() |
0.634 | D0P1RL | ![]() |
0.343 | ||
| ENC000157 | ![]() |
0.621 | D00FGR | ![]() |
0.330 | ||
| ENC000300 | ![]() |
0.590 | D07ILQ | ![]() |
0.327 | ||