![]() |
Name |
claudine A
|
Molecular Formula | C18H23N | |
IUPAC Name* |
3-(2-methylbut-3-en-2-yl)-5-(3-methylbut-2-enyl)-1H-indole
|
|
SMILES |
C=CC(C)(C)c1c[nH]c2ccc(CC=C(C)C)cc12
|
|
InChI |
InChI=1S/C18H23N/c1-6-18(4,5)16-12-19-17-10-9-14(11-15(16)17)8-7-13(2)3/h6-7,9-12,19H,1,8H2,2-5H3
|
|
InChIKey |
NIXWBHVKRBIARO-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 253.39 | ALogp: | 5.1 |
HBD: | 1 | HBA: | 0 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 15.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.698 |
Caco-2 Permeability: | -4.757 | MDCK Permeability: | 0.00001020 |
Pgp-inhibitor: | 0.976 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.914 |
30% Bioavailability (F30%): | 0.915 |
Blood-Brain-Barrier Penetration (BBB): | 0.078 | Plasma Protein Binding (PPB): | 97.08% |
Volume Distribution (VD): | 5.3 | Fu: | 4.12% |
CYP1A2-inhibitor: | 0.98 | CYP1A2-substrate: | 0.455 |
CYP2C19-inhibitor: | 0.96 | CYP2C19-substrate: | 0.47 |
CYP2C9-inhibitor: | 0.893 | CYP2C9-substrate: | 0.94 |
CYP2D6-inhibitor: | 0.918 | CYP2D6-substrate: | 0.88 |
CYP3A4-inhibitor: | 0.907 | CYP3A4-substrate: | 0.334 |
Clearance (CL): | 4.077 | Half-life (T1/2): | 0.15 |
hERG Blockers: | 0.068 | Human Hepatotoxicity (H-HT): | 0.401 |
Drug-inuced Liver Injury (DILI): | 0.108 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.106 | Maximum Recommended Daily Dose: | 0.883 |
Skin Sensitization: | 0.85 | Carcinogencity: | 0.094 |
Eye Corrosion: | 0.017 | Eye Irritation: | 0.829 |
Respiratory Toxicity: | 0.339 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002096 | ![]() |
0.493 | D0Z6UC | ![]() |
0.321 | ||
ENC002068 | ![]() |
0.472 | D0AN7B | ![]() |
0.316 | ||
ENC002630 | ![]() |
0.472 | D0S9MU | ![]() |
0.294 | ||
ENC002447 | ![]() |
0.440 | D0O2YE | ![]() |
0.292 | ||
ENC006144 | ![]() |
0.440 | D0NG7O | ![]() |
0.287 | ||
ENC003865 | ![]() |
0.417 | D0P0SM | ![]() |
0.272 | ||
ENC001366 | ![]() |
0.394 | D0T3KI | ![]() |
0.272 | ||
ENC004149 | ![]() |
0.359 | D00XWD | ![]() |
0.264 | ||
ENC002214 | ![]() |
0.352 | D0W7WC | ![]() |
0.262 | ||
ENC002069 | ![]() |
0.351 | D05EJG | ![]() |
0.237 |