![]() |
Name |
21-O-deacetyl-L-696,474
|
Molecular Formula | C28H37NO3 | |
IUPAC Name* |
16-benzyl-2,12-dihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-18-one
|
|
SMILES |
C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23C(O)C=CC(C)CC(C)CC=CC3C1O
|
|
InChI |
InChI=1S/C28H37NO3/c1-17-9-8-12-22-26(31)20(4)19(3)25-23(16-21-10-6-5-7-11-21)29-27(32)28(22,25)24(30)14-13-18(2)15-17/h5-8,10-14,17-19,22-26,30-31H,4,9,15-16H2,1-3H3,(H,29,32)/b12-8+,14-13+/t17-,18+,19+,22-,23-,24+,25-,26+,28+/m0/s1
|
|
InChIKey |
CZWPJPMFISENGB-MCQWGARUSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 435.61 | ALogp: | 4.1 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 69.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 32 | QED Weighted: | 0.592 |
Caco-2 Permeability: | -4.92 | MDCK Permeability: | 0.00013844 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.131 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.965 | Plasma Protein Binding (PPB): | 95.55% |
Volume Distribution (VD): | 1.436 | Fu: | 4.68% |
CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.254 |
CYP2C19-inhibitor: | 0.258 | CYP2C19-substrate: | 0.287 |
CYP2C9-inhibitor: | 0.316 | CYP2C9-substrate: | 0.663 |
CYP2D6-inhibitor: | 0.044 | CYP2D6-substrate: | 0.579 |
CYP3A4-inhibitor: | 0.886 | CYP3A4-substrate: | 0.37 |
Clearance (CL): | 9.921 | Half-life (T1/2): | 0.016 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.008 |
Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.767 | Maximum Recommended Daily Dose: | 0.623 |
Skin Sensitization: | 0.019 | Carcinogencity: | 0.063 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.954 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004120 | ![]() |
0.847 | D0I0DL | ![]() |
0.254 | ||
ENC004118 | ![]() |
0.818 | D06CWH | ![]() |
0.245 | ||
ENC003718 | ![]() |
0.818 | D0SP3D | ![]() |
0.240 | ||
ENC004369 | ![]() |
0.800 | D09NNH | ![]() |
0.240 | ||
ENC004119 | ![]() |
0.800 | D0V3ZA | ![]() |
0.240 | ||
ENC004370 | ![]() |
0.782 | D0D7KC | ![]() |
0.239 | ||
ENC004243 | ![]() |
0.782 | D0H6TP | ![]() |
0.231 | ||
ENC003955 | ![]() |
0.762 | D0IN7I | ![]() |
0.231 | ||
ENC004544 | ![]() |
0.760 | D0UA0I | ![]() |
0.231 | ||
ENC004918 | ![]() |
0.760 | D05VQI | ![]() |
0.231 |