|
Name |
Diaporthichalasin E
|
| Molecular Formula | C28H37NO4 | |
| IUPAC Name* |
(1R,2R,3E,5R,6R,7S,9E,11R,12S,14S,15R,16S)-16-benzyl-2,6,12-trihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-18-one
|
|
| SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H](C(=C)[C@H]([C@@H]3[C@@]2([C@@H](/C=C/[C@H]([C@@H]1O)C)O)C(=O)N[C@H]3CC4=CC=CC=C4)C)O
|
|
| InChI |
InChI=1S/C28H37NO4/c1-16-9-8-12-21-26(32)19(4)18(3)24-22(15-20-10-6-5-7-11-20)29-27(33)28(21,24)23(30)14-13-17(2)25(16)31/h5-8,10-14,16-18,21-26,30-32H,4,9,15H2,1-3H3,(H,29,33)/b12-8+,14-13+/t16-,17+,18+,21-,22-,23+,24-,25+,26+,28+/m0/s1
|
|
| InChIKey |
ILNCZWAAMKIBMP-RBYSCGISSA-N
|
|
| Synonyms |
Diaporthichalasin E
|
|
| CAS | NA | |
| PubChem CID | 156582432 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 451.6 | ALogp: | 3.1 |
| HBD: | 4 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 89.8 | Aromatic Rings: | 4 |
| Heavy Atoms: | 33 | QED Weighted: | 0.515 |
| Caco-2 Permeability: | -5.359 | MDCK Permeability: | 0.00001090 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.96 |
| Human Intestinal Absorption (HIA): | 0.631 | 20% Bioavailability (F20%): | 0.761 |
| 30% Bioavailability (F30%): | 0.066 |
| Blood-Brain-Barrier Penetration (BBB): | 0.035 | Plasma Protein Binding (PPB): | 77.65% |
| Volume Distribution (VD): | 0.932 | Fu: | 3.44% |
| CYP1A2-inhibitor: | 0.051 | CYP1A2-substrate: | 0.146 |
| CYP2C19-inhibitor: | 0.048 | CYP2C19-substrate: | 0.793 |
| CYP2C9-inhibitor: | 0.056 | CYP2C9-substrate: | 0.202 |
| CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.197 |
| CYP3A4-inhibitor: | 0.753 | CYP3A4-substrate: | 0.237 |
| Clearance (CL): | 2.446 | Half-life (T1/2): | 0.238 |
| hERG Blockers: | 0.164 | Human Hepatotoxicity (H-HT): | 0.652 |
| Drug-inuced Liver Injury (DILI): | 0.578 | AMES Toxicity: | 0.031 |
| Rat Oral Acute Toxicity: | 0.951 | Maximum Recommended Daily Dose: | 0.988 |
| Skin Sensitization: | 0.106 | Carcinogencity: | 0.009 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.969 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC006133 | ![]() |
0.800 | D0I0DL | ![]() |
0.240 | ||
| ENC004120 | ![]() |
0.760 | D0D7KC | ![]() |
0.228 | ||
| ENC004370 | ![]() |
0.733 | D0H6TP | ![]() |
0.227 | ||
| ENC004243 | ![]() |
0.733 | D06CWH | ![]() |
0.226 | ||
| ENC003955 | ![]() |
0.731 | D0SP3D | ![]() |
0.224 | ||
| ENC002183 | ![]() |
0.729 | D09NNH | ![]() |
0.223 | ||
| ENC004544 | ![]() |
0.697 | D0V3ZA | ![]() |
0.223 | ||
| ENC004918 | ![]() |
0.697 | D0R1BD | ![]() |
0.222 | ||
| ENC003718 | ![]() |
0.670 | D0IN7I | ![]() |
0.219 | ||
| ENC004118 | ![]() |
0.670 | D0B6CC | ![]() |
0.217 | ||