![]() |
Name |
Diaporthichalasin C
|
Molecular Formula | C28H37NO4 | |
IUPAC Name* |
(1R,2R,3E,5S,7S,9E,11R,12S,14S,15R,16S)-16-benzyl-2,12-dihydroxy-7-(hydroxymethyl)-5,14-dimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-18-one
|
|
SMILES |
C[C@H]\1C[C@H](C/C=C/[C@H]2[C@@H](C(=C)[C@H]([C@@H]3[C@@]2([C@@H](/C=C1)O)C(=O)N[C@H]3CC4=CC=CC=C4)C)O)CO
|
|
InChI |
InChI=1S/C28H37NO4/c1-17-12-13-24(31)28-22(11-7-10-21(14-17)16-30)26(32)19(3)18(2)25(28)23(29-27(28)33)15-20-8-5-4-6-9-20/h4-9,11-13,17-18,21-26,30-32H,3,10,14-16H2,1-2H3,(H,29,33)/b11-7+,13-12+/t17-,18-,21+,22+,23+,24-,25+,26-,28-/m1/s1
|
|
InChIKey |
LEEMZEPUCVSMLK-VYUOJDJFSA-N
|
|
Synonyms |
Diaporthichalasin C
|
|
CAS | NA | |
PubChem CID | 146683414 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 451.6 | ALogp: | 2.8 |
HBD: | 4 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 89.8 | Aromatic Rings: | 4 |
Heavy Atoms: | 33 | QED Weighted: | 0.526 |
Caco-2 Permeability: | -5.461 | MDCK Permeability: | 0.00001050 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.988 |
Human Intestinal Absorption (HIA): | 0.739 | 20% Bioavailability (F20%): | 0.855 |
30% Bioavailability (F30%): | 0.823 |
Blood-Brain-Barrier Penetration (BBB): | 0.196 | Plasma Protein Binding (PPB): | 78.40% |
Volume Distribution (VD): | 0.724 | Fu: | 4.11% |
CYP1A2-inhibitor: | 0.04 | CYP1A2-substrate: | 0.12 |
CYP2C19-inhibitor: | 0.098 | CYP2C19-substrate: | 0.622 |
CYP2C9-inhibitor: | 0.188 | CYP2C9-substrate: | 0.213 |
CYP2D6-inhibitor: | 0.015 | CYP2D6-substrate: | 0.262 |
CYP3A4-inhibitor: | 0.825 | CYP3A4-substrate: | 0.217 |
Clearance (CL): | 4.487 | Half-life (T1/2): | 0.331 |
hERG Blockers: | 0.184 | Human Hepatotoxicity (H-HT): | 0.825 |
Drug-inuced Liver Injury (DILI): | 0.786 | AMES Toxicity: | 0.052 |
Rat Oral Acute Toxicity: | 0.936 | Maximum Recommended Daily Dose: | 0.995 |
Skin Sensitization: | 0.386 | Carcinogencity: | 0.021 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
Respiratory Toxicity: | 0.97 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006133 | ![]() |
0.847 | D0I0DL | ![]() |
0.258 | ||
ENC004370 | ![]() |
0.760 | D0UA0I | ![]() |
0.243 | ||
ENC004369 | ![]() |
0.760 | D0D7KC | ![]() |
0.243 | ||
ENC004243 | ![]() |
0.726 | D06CWH | ![]() |
0.240 | ||
ENC003955 | ![]() |
0.724 | D0V3ZA | ![]() |
0.236 | ||
ENC004118 | ![]() |
0.710 | D0B6CC | ![]() |
0.234 | ||
ENC003718 | ![]() |
0.710 | D0SP3D | ![]() |
0.230 | ||
ENC004119 | ![]() |
0.694 | D09NNH | ![]() |
0.229 | ||
ENC004918 | ![]() |
0.691 | D0NS6H | ![]() |
0.227 | ||
ENC004544 | ![]() |
0.691 | D0C6NM | ![]() |
0.226 |