|
Name |
24-α-D-glucosyl-(-)-terpestacin
|
| Molecular Formula | C31H48O9 | |
| IUPAC Name* |
5,17-dihydroxy-4,8,12,15-tetramethyl-18-[1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]bicyclo[13.3.0]octadeca-3,8,12,17-tetraen-16-one
|
|
| SMILES |
CC1=CCC2(C)C(=O)C(O)=C(C(C)COC3OC(CO)C(O)C(O)C3O)C2CC=C(C)C(O)CCC(C)=CCC1
|
|
| InChI |
InChI=1S/C31H48O9/c1-17-7-6-8-18(2)13-14-31(5)21(11-10-19(3)22(33)12-9-17)24(26(35)29(31)38)20(4)16-39-30-28(37)27(36)25(34)23(15-32)40-30/h7,10,13,20-23,25,27-28,30,32-37H,6,8-9,11-12,14-16H2,1-5H3/b17-7+,18-13+,19-10+/t20-,21-,22+,23-,25-,27+,28-,30+,31+/m1/s1
|
|
| InChIKey |
RVSWMQVCYJCHMC-MEDLHAJDSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 564.72 | ALogp: | 3.0 |
| HBD: | 6 | HBA: | 9 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 156.9 | Aromatic Rings: | 3 |
| Heavy Atoms: | 40 | QED Weighted: | 0.273 |
| Caco-2 Permeability: | -5.282 | MDCK Permeability: | 0.00000913 |
| Pgp-inhibitor: | 0.98 | Pgp-substrate: | 0.075 |
| Human Intestinal Absorption (HIA): | 0.944 | 20% Bioavailability (F20%): | 0.297 |
| 30% Bioavailability (F30%): | 0.96 |
| Blood-Brain-Barrier Penetration (BBB): | 0.09 | Plasma Protein Binding (PPB): | 84.74% |
| Volume Distribution (VD): | 1.61 | Fu: | 8.02% |
| CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.117 |
| CYP2C19-inhibitor: | 0.008 | CYP2C19-substrate: | 0.269 |
| CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.151 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.077 |
| CYP3A4-inhibitor: | 0.039 | CYP3A4-substrate: | 0.222 |
| Clearance (CL): | 1.386 | Half-life (T1/2): | 0.074 |
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.373 |
| Drug-inuced Liver Injury (DILI): | 0.146 | AMES Toxicity: | 0.227 |
| Rat Oral Acute Toxicity: | 0.193 | Maximum Recommended Daily Dose: | 0.702 |
| Skin Sensitization: | 0.125 | Carcinogencity: | 0.596 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
| Respiratory Toxicity: | 0.435 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001882 | ![]() |
0.676 | D0S0NK | ![]() |
0.356 | ||
| ENC002974 | ![]() |
0.676 | D06BQU | ![]() |
0.283 | ||
| ENC003560 | ![]() |
0.676 | D0T5BC | ![]() |
0.269 | ||
| ENC003210 | ![]() |
0.644 | D04RYU | ![]() |
0.268 | ||
| ENC005683 | ![]() |
0.602 | D0I9HF | ![]() |
0.263 | ||
| ENC004376 | ![]() |
0.512 | D0AR3J | ![]() |
0.257 | ||
| ENC005685 | ![]() |
0.488 | D0TC7C | ![]() |
0.257 | ||
| ENC004109 | ![]() |
0.488 | D06ALD | ![]() |
0.256 | ||
| ENC005684 | ![]() |
0.480 | D0H3KI | ![]() |
0.241 | ||
| ENC002993 | ![]() |
0.344 | D01TNW | ![]() |
0.240 | ||