|
Name |
5,17-Dihydroxy-18-(1-hydroxypropan-2-yl)-4,8,12,15-tetramethylbicyclo[13.3.0]octadeca-3,8,12,17-tetraen-16-one
|
| Molecular Formula | C25H38O4 | |
| IUPAC Name* |
5,17-dihydroxy-18-(1-hydroxypropan-2-yl)-4,8,12,15-tetramethylbicyclo[13.3.0]octadeca-3,8,12,17-tetraen-16-one
|
|
| SMILES |
CC1=CCCC(=CCC2(C(CC=C(C(CC1)O)C)C(=C(C2=O)O)C(C)CO)C)C
|
|
| InChI |
InChI=1S/C25H38O4/c1-16-7-6-8-17(2)13-14-25(5)20(11-10-18(3)21(27)12-9-16)22(19(4)15-26)23(28)24(25)29/h7,10,13,19-21,26-28H,6,8-9,11-12,14-15H2,1-5H3
|
|
| InChIKey |
UTGBBPSEQPITLF-UHFFFAOYSA-N
|
|
| Synonyms |
Terpestacin; 11-epiterpestacin; 146436-22-8; BCP19384; FT-0699690; 1(3aH)-Cyclopentacyclopentadecenone,4,7,8,9,12,13,16,16a-octahydro-2,7-dihydroxy-3-[(1S)-2-hydroxy-1-methylethyl]-6,10,14,16a-tetramethyl-,(3aR,5E,7S,10E,14E,16aS)-
|
|
| CAS | NA | |
| PubChem CID | 73208120 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 402.6 | ALogp: | 2.9 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 77.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 29 | QED Weighted: | 0.535 |
| Caco-2 Permeability: | -4.588 | MDCK Permeability: | 0.00001980 |
| Pgp-inhibitor: | 0.968 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.476 | 20% Bioavailability (F20%): | 0.724 |
| 30% Bioavailability (F30%): | 0.076 |
| Blood-Brain-Barrier Penetration (BBB): | 0.847 | Plasma Protein Binding (PPB): | 88.24% |
| Volume Distribution (VD): | 2.109 | Fu: | 5.14% |
| CYP1A2-inhibitor: | 0.034 | CYP1A2-substrate: | 0.292 |
| CYP2C19-inhibitor: | 0.041 | CYP2C19-substrate: | 0.581 |
| CYP2C9-inhibitor: | 0.046 | CYP2C9-substrate: | 0.28 |
| CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.103 |
| CYP3A4-inhibitor: | 0.66 | CYP3A4-substrate: | 0.386 |
| Clearance (CL): | 12.203 | Half-life (T1/2): | 0.079 |
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.239 |
| Drug-inuced Liver Injury (DILI): | 0.149 | AMES Toxicity: | 0.022 |
| Rat Oral Acute Toxicity: | 0.091 | Maximum Recommended Daily Dose: | 0.587 |
| Skin Sensitization: | 0.952 | Carcinogencity: | 0.599 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.018 |
| Respiratory Toxicity: | 0.163 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003560 | ![]() |
1.000 | D00ZFP | ![]() |
0.239 | ||
| ENC003210 | ![]() |
0.802 | D0P1FO | ![]() |
0.224 | ||
| ENC005683 | ![]() |
0.722 | D0KR5B | ![]() |
0.221 | ||
| ENC006130 | ![]() |
0.676 | D04GJN | ![]() |
0.217 | ||
| ENC005684 | ![]() |
0.663 | D01CKY | ![]() |
0.215 | ||
| ENC005685 | ![]() |
0.656 | D04ATM | ![]() |
0.215 | ||
| ENC004109 | ![]() |
0.656 | D0K0EK | ![]() |
0.212 | ||
| ENC004376 | ![]() |
0.576 | D02ZGI | ![]() |
0.212 | ||
| ENC003502 | ![]() |
0.408 | D0T2PL | ![]() |
0.212 | ||
| ENC003463 | ![]() |
0.385 | D08SVH | ![]() |
0.212 | ||