NPs Basic Information
|
Name |
Terpestacin
|
| Molecular Formula | C25H38O4 | |
| IUPAC Name* |
(1R,3E,5S,8E,12E,15S)-5,17-dihydroxy-18-[(2S)-1-hydroxypropan-2-yl]-4,8,12,15-tetramethylbicyclo[13.3.0]octadeca-3,8,12,17-tetraen-16-one
|
|
| SMILES |
C/C/1=C\CC/C(=C/C[C@]2([C@H](C/C=C(/[C@H](CC1)O)\C)C(=C(C2=O)O)[C@H](C)CO)C)/C
|
|
| InChI |
InChI=1S/C25H38O4/c1-16-7-6-8-17(2)13-14-25(5)20(11-10-18(3)21(27)12-9-16)22(19(4)15-26)23(28)24(25)29/h7,10,13,19-21,26-28H,6,8-9,11-12,14-15H2,1-5H3/b16-7+,17-13+,18-10+/t19-,20-,21+,25+/m1/s1
|
|
| InChIKey |
UTGBBPSEQPITLF-IXRUDUFRSA-N
|
|
| Synonyms |
Terpestacin; (-)-terpestacin; GF9UM66CY6; SICCANOL; DEACETYLFUSAPROLIFERIN; CHEMBL1669042; ACon1_002207; 1(3aH)-Cyclopentacyclopentadecenone, 4,7,8,9,12,13,16,16a-octahydro-2,7-dihydroxy-3-(2-hydroxy-1-methylethyl)-6,10,14,16a-tetramethyl-, (3aR-(3(S*),3aR*,5E,7S*,10E,14E,16aS*))-; 146436-22-8; BU-4641V; ZINC31159538; NCGC00381199-01; (1R,3E,5S,8E,12E,15S)-5,17-dihydroxy-18-[(2S)-1-hydroxypropan-2-yl]-4,8,12,15-tetramethylbicyclo[13.3.0]octadeca-3,8,12,17-tetraen-16-one; (1S,11S,15R,23S)-TERPESTACIN; Q15427890; (1R,3E,5S,8E,12E,15S)-5,17-dihydroxy-18-[(1S)-2-hydroxy-1-methyl-ethyl]-4,8,12,15-tetramethyl-bicyclo[13.3.0]octadeca-3,8,12,17-tetraen-16-one; (3AR,5E,7S,10E,14E,16AS)-4,7,8,9,12,13,16,16A-OCTAHYDRO-2,7-DIHYDROXY-3-((1S)-2-HYDROXY-1-METHYLETHYL)-6,10,14,16A-TETRAMETHYL-1(3AH)-CYCLOPENTACYCLOPENTADECENONE; 1(3AH)-CYCLOPENTACYCLOPENTADECENONE, 4,7,8,9,12,13,16,16A-OCTAHYDRO-2,7-DIHYDROXY-3-((1S)-2-HYDROXY-1-METHYLETHYL)-6,10,14,16A-TETRAMETHYL-, (3AR,5E,7S,10E,14E,16AS)-
|
|
| CAS | 146436-22-8 | |
| PubChem CID | 6475118 | |
| ChEMBL ID | CHEMBL1669042 |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Physi-Chem Properties
| Molecular Weight: | 402.6 | ALogp: | 2.9 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 77.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 29 | QED Weighted: | 0.535 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.68 | MDCK Permeability: | 0.00002440 |
| Pgp-inhibitor: | 0.993 | Pgp-substrate: | 0.016 |
| Human Intestinal Absorption (HIA): | 0.777 | 20% Bioavailability (F20%): | 0.213 |
| 30% Bioavailability (F30%): | 0.114 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.848 | Plasma Protein Binding (PPB): | 83.13% |
| Volume Distribution (VD): | 0.609 | Fu: | 4.10% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.03 | CYP1A2-substrate: | 0.316 |
| CYP2C19-inhibitor: | 0.043 | CYP2C19-substrate: | 0.556 |
| CYP2C9-inhibitor: | 0.052 | CYP2C9-substrate: | 0.157 |
| CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.104 |
| CYP3A4-inhibitor: | 0.794 | CYP3A4-substrate: | 0.397 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 7.037 | Half-life (T1/2): | 0.179 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.148 |
| Drug-inuced Liver Injury (DILI): | 0.072 | AMES Toxicity: | 0.01 |
| Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.849 |
| Skin Sensitization: | 0.966 | Carcinogencity: | 0.056 |
| Eye Corrosion: | 0.018 | Eye Irritation: | 0.047 |
| Respiratory Toxicity: | 0.759 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
Showing 1 to 10 of 10 entries