|
Name |
methyl (3R,5S,8R,9S,10R,13S,14S)-3-acetyloxy-10-formyl-4,4,8,12,13,16-hexamethyl-15,17-dioxo-2,3,5,6,7,9-hexahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate
|
| Molecular Formula | C28H38O7 | |
| IUPAC Name* |
methyl (3R,5S,8R,9S,10R,13S,14S)-3-acetyloxy-10-formyl-4,4,8,12,13,16-hexamethyl-15,17-dioxo-2,3,5,6,7,9-hexahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate
|
|
| SMILES |
CC1C(=O)[C@]2(C(=C[C@H]3[C@]([C@]2(C1=O)C(=O)OC)(CC[C@@H]4[C@@]3(CC[C@H](C4(C)C)OC(=O)C)C=O)C)C)C
|
|
| InChI |
InChI=1S/C28H38O7/c1-15-13-19-25(6,28(23(33)34-8)22(32)16(2)21(31)26(15,28)7)11-9-18-24(4,5)20(35-17(3)30)10-12-27(18,19)14-29/h13-14,16,18-20H,9-12H2,1-8H3/t16?,18-,19-,20+,25+,26+,27+,28-/m0/s1
|
|
| InChIKey |
GRBXNADBNJGZRK-FMCJHFEWSA-N
|
|
| Synonyms |
Andrastin A; 174232-42-9
|
|
| CAS | NA | |
| PubChem CID | 133556494 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 486.6 | ALogp: | 3.8 |
| HBD: | 0 | HBA: | 7 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 104.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 35 | QED Weighted: | 0.25 |
| Caco-2 Permeability: | -5.27 | MDCK Permeability: | 0.00001490 |
| Pgp-inhibitor: | 0.982 | Pgp-substrate: | 0.111 |
| Human Intestinal Absorption (HIA): | 0.033 | 20% Bioavailability (F20%): | 0.877 |
| 30% Bioavailability (F30%): | 0.97 |
| Blood-Brain-Barrier Penetration (BBB): | 0.972 | Plasma Protein Binding (PPB): | 56.66% |
| Volume Distribution (VD): | 1.61 | Fu: | 52.03% |
| CYP1A2-inhibitor: | 0.006 | CYP1A2-substrate: | 0.603 |
| CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.668 |
| CYP2C9-inhibitor: | 0.016 | CYP2C9-substrate: | 0.044 |
| CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.047 |
| CYP3A4-inhibitor: | 0.853 | CYP3A4-substrate: | 0.731 |
| Clearance (CL): | 6.197 | Half-life (T1/2): | 0.153 |
| hERG Blockers: | 0 | Human Hepatotoxicity (H-HT): | 0.149 |
| Drug-inuced Liver Injury (DILI): | 0.77 | AMES Toxicity: | 0.598 |
| Rat Oral Acute Toxicity: | 0.907 | Maximum Recommended Daily Dose: | 0.746 |
| Skin Sensitization: | 0.47 | Carcinogencity: | 0.767 |
| Eye Corrosion: | 0.993 | Eye Irritation: | 0.832 |
| Respiratory Toxicity: | 0.945 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005963 | ![]() |
0.788 | D0V2JK | ![]() |
0.297 | ||
| ENC001949 | ![]() |
0.631 | D0H2MO | ![]() |
0.290 | ||
| ENC004115 | ![]() |
0.617 | D0X4RS | ![]() |
0.276 | ||
| ENC005965 | ![]() |
0.617 | D0X7XG | ![]() |
0.273 | ||
| ENC002012 | ![]() |
0.614 | D04GJN | ![]() |
0.270 | ||
| ENC005964 | ![]() |
0.560 | D0I2SD | ![]() |
0.260 | ||
| ENC003138 | ![]() |
0.533 | D0R2KY | ![]() |
0.259 | ||
| ENC002033 | ![]() |
0.479 | D08BDT | ![]() |
0.259 | ||
| ENC001833 | ![]() |
0.353 | D06AEO | ![]() |
0.254 | ||
| ENC001394 | ![]() |
0.343 | D02CNR | ![]() |
0.252 | ||