![]() |
Name |
Epicoterpene A
|
Molecular Formula | C15H22O3 | |
IUPAC Name* |
6-(hydroxymethyl)-6,7b-dimethyl-2,4,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-3-carboxylicacid
|
|
SMILES |
CC1(CO)CC2CC(C(=O)O)=C3CCC3(C)C2C1
|
|
InChI |
InChI=1S/C15H22O3/c1-14(8-16)6-9-5-10(13(17)18)11-3-4-15(11,2)12(9)7-14/h9,12,16H,3-8H2,1-2H3,(H,17,18)/t9-,12+,14-,15-/m1/s1
|
|
InChIKey |
ALYYAWYGCVMZMR-OCCNTAHWSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 250.34 | ALogp: | 2.6 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 3 |
Heavy Atoms: | 18 | QED Weighted: | 0.79 |
Caco-2 Permeability: | -4.987 | MDCK Permeability: | 0.00001250 |
Pgp-inhibitor: | 0.032 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.176 | Plasma Protein Binding (PPB): | 87.03% |
Volume Distribution (VD): | 0.487 | Fu: | 17.00% |
CYP1A2-inhibitor: | 0.035 | CYP1A2-substrate: | 0.695 |
CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.75 |
CYP2C9-inhibitor: | 0.088 | CYP2C9-substrate: | 0.129 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.263 |
CYP3A4-inhibitor: | 0.083 | CYP3A4-substrate: | 0.261 |
Clearance (CL): | 6.277 | Half-life (T1/2): | 0.674 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.458 |
Drug-inuced Liver Injury (DILI): | 0.309 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.019 | Maximum Recommended Daily Dose: | 0.093 |
Skin Sensitization: | 0.057 | Carcinogencity: | 0.151 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.037 |
Respiratory Toxicity: | 0.737 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002346 | ![]() |
0.475 | D0KR5B | ![]() |
0.304 | ||
ENC002934 | ![]() |
0.326 | D0IX6I | ![]() |
0.290 | ||
ENC003162 | ![]() |
0.309 | D0D1SG | ![]() |
0.277 | ||
ENC002919 | ![]() |
0.297 | D0I1LH | ![]() |
0.274 | ||
ENC005748 | ![]() |
0.295 | D04SFH | ![]() |
0.272 | ||
ENC002922 | ![]() |
0.293 | D0R7JT | ![]() |
0.271 | ||
ENC003909 | ![]() |
0.293 | D0Y2YP | ![]() |
0.267 | ||
ENC003908 | ![]() |
0.293 | D0IL7L | ![]() |
0.263 | ||
ENC003907 | ![]() |
0.293 | D04GJN | ![]() |
0.258 | ||
ENC005922 | ![]() |
0.293 | D0I2SD | ![]() |
0.258 |