|
Name |
(3aS,5aR,6S,9aS)-3a-(hydroxymethyl)-6,9a-dimethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-6-carboxylic acid
|
| Molecular Formula | C16H24O5 | |
| IUPAC Name* |
(3aS,5aR,6S,9aS)-3a-(hydroxymethyl)-6,9a-dimethyl-2-oxo-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-6-carboxylic acid
|
|
| SMILES |
C[C@]12CCC[C@]([C@@H]1CC[C@]3(C2CC(=O)O3)CO)(C)C(=O)O
|
|
| InChI |
InChI=1S/C16H24O5/c1-14-5-3-6-15(2,13(19)20)10(14)4-7-16(9-17)11(14)8-12(18)21-16/h10-11,17H,3-9H2,1-2H3,(H,19,20)/t10-,11?,14+,15+,16-/m1/s1
|
|
| InChIKey |
QQXUVFDWBIAEDS-FEEKDDLXSA-N
|
|
| Synonyms |
Asperolide C
|
|
| CAS | NA | |
| PubChem CID | 101558916 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 296.36 | ALogp: | 1.8 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 83.8 | Aromatic Rings: | 3 |
| Heavy Atoms: | 21 | QED Weighted: | 0.765 |
| Caco-2 Permeability: | -5.85 | MDCK Permeability: | 0.00007350 |
| Pgp-inhibitor: | 0.057 | Pgp-substrate: | 0.005 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.143 |
| 30% Bioavailability (F30%): | 0.288 |
| Blood-Brain-Barrier Penetration (BBB): | 0.353 | Plasma Protein Binding (PPB): | 43.54% |
| Volume Distribution (VD): | 0.344 | Fu: | 40.64% |
| CYP1A2-inhibitor: | 0.004 | CYP1A2-substrate: | 0.873 |
| CYP2C19-inhibitor: | 0.008 | CYP2C19-substrate: | 0.702 |
| CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0.122 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.096 |
| CYP3A4-inhibitor: | 0.11 | CYP3A4-substrate: | 0.135 |
| Clearance (CL): | 2.97 | Half-life (T1/2): | 0.634 |
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.339 |
| Drug-inuced Liver Injury (DILI): | 0.02 | AMES Toxicity: | 0.014 |
| Rat Oral Acute Toxicity: | 0.023 | Maximum Recommended Daily Dose: | 0.197 |
| Skin Sensitization: | 0.107 | Carcinogencity: | 0.461 |
| Eye Corrosion: | 0.096 | Eye Irritation: | 0.072 |
| Respiratory Toxicity: | 0.873 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002603 | ![]() |
0.583 | D01CKY | ![]() |
0.326 | ||
| ENC001452 | ![]() |
0.514 | D0U3GL | ![]() |
0.283 | ||
| ENC003143 | ![]() |
0.486 | D0IX6I | ![]() |
0.280 | ||
| ENC005922 | ![]() |
0.458 | D0KR5B | ![]() |
0.280 | ||
| ENC002438 | ![]() |
0.436 | D0R7JT | ![]() |
0.275 | ||
| ENC001071 | ![]() |
0.425 | D0EP0C | ![]() |
0.266 | ||
| ENC001844 | ![]() |
0.424 | D04VIS | ![]() |
0.263 | ||
| ENC002902 | ![]() |
0.418 | D04GJN | ![]() |
0.263 | ||
| ENC005547 | ![]() |
0.418 | D0I2SD | ![]() |
0.263 | ||
| ENC002923 | ![]() |
0.405 | D0Q4SD | ![]() |
0.259 | ||