![]() |
Name |
Acaciicolinol J
|
Molecular Formula | C15H24O3 | |
IUPAC Name* |
(6R)-4-hydroxy-9-(hydroxymethyl)-1,5,5-trimethylspiro[5.5]undec-9-en-2-one
|
|
SMILES |
CC1C(=O)CC(C([C@@]12CCC(=CC2)CO)(C)C)O
|
|
InChI |
InChI=1S/C15H24O3/c1-10-12(17)8-13(18)14(2,3)15(10)6-4-11(9-16)5-7-15/h4,10,13,16,18H,5-9H2,1-3H3/t10?,13?,15-/m0/s1
|
|
InChIKey |
IVAZEZHNXPTPQF-KHXKVGHRSA-N
|
|
Synonyms |
Acaciicolinol J
|
|
CAS | NA | |
PubChem CID | 139590769 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 252.35 | ALogp: | 1.3 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.705 |
Caco-2 Permeability: | -4.486 | MDCK Permeability: | 0.00001160 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.007 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.975 |
30% Bioavailability (F30%): | 0.79 |
Blood-Brain-Barrier Penetration (BBB): | 0.797 | Plasma Protein Binding (PPB): | 47.02% |
Volume Distribution (VD): | 0.773 | Fu: | 45.94% |
CYP1A2-inhibitor: | 0.022 | CYP1A2-substrate: | 0.12 |
CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.483 |
CYP2C9-inhibitor: | 0.013 | CYP2C9-substrate: | 0.317 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.327 |
CYP3A4-inhibitor: | 0.031 | CYP3A4-substrate: | 0.22 |
Clearance (CL): | 6.57 | Half-life (T1/2): | 0.834 |
hERG Blockers: | 0.02 | Human Hepatotoxicity (H-HT): | 0.161 |
Drug-inuced Liver Injury (DILI): | 0.078 | AMES Toxicity: | 0.025 |
Rat Oral Acute Toxicity: | 0.502 | Maximum Recommended Daily Dose: | 0.178 |
Skin Sensitization: | 0.118 | Carcinogencity: | 0.768 |
Eye Corrosion: | 0.008 | Eye Irritation: | 0.266 |
Respiratory Toxicity: | 0.283 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003906 | ![]() |
0.548 | D0H1QY | ![]() |
0.283 | ||
ENC003907 | ![]() |
0.548 | D0K0EK | ![]() |
0.274 | ||
ENC003908 | ![]() |
0.548 | D0CZ1Q | ![]() |
0.274 | ||
ENC003903 | ![]() |
0.500 | D0L2LS | ![]() |
0.270 | ||
ENC003913 | ![]() |
0.485 | D07DVK | ![]() |
0.268 | ||
ENC003905 | ![]() |
0.455 | D0CW1P | ![]() |
0.268 | ||
ENC003911 | ![]() |
0.455 | D0IT2G | ![]() |
0.268 | ||
ENC003897 | ![]() |
0.418 | D0G6AB | ![]() |
0.264 | ||
ENC003912 | ![]() |
0.412 | D04VIS | ![]() |
0.261 | ||
ENC005118 | ![]() |
0.412 | D0R7JT | ![]() |
0.260 |