|
Name |
jammosporin A
|
| Molecular Formula | C30H39NO7 | |
| IUPAC Name* |
(17-benzyl-6,13-dihydroxy-6,8,14,15-tetramethyl-7,19-dioxo-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadec-10-en-2-yl)acetate
|
|
| SMILES |
CC(=O)OC1C2OC2C(C)(O)C(=O)C(C)CC=CC2C(O)C(C)C(C)C3C(Cc4ccccc4)NC(=O)C213
|
|
| InChI |
InChI=1S/C30H39NO7/c1-15-10-9-13-20-23(33)17(3)16(2)22-21(14-19-11-7-6-8-12-19)31-28(35)30(20,22)27(37-18(4)32)24-26(38-24)29(5,36)25(15)34/h6-9,11-13,15-17,20-24,26-27,33,36H,10,14H2,1-5H3,(H,31,35)/b13-9+/t15-,16+,17-,20-,21-,22-,23+,24-,26-,27+,29-,30-/m0/s1
|
|
| InChIKey |
WBAHWIITACOYNM-UARODANCSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 525.64 | ALogp: | 2.2 |
| HBD: | 3 | HBA: | 7 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 125.5 | Aromatic Rings: | 5 |
| Heavy Atoms: | 38 | QED Weighted: | 0.315 |
| Caco-2 Permeability: | -5.014 | MDCK Permeability: | 0.00008700 |
| Pgp-inhibitor: | 0.582 | Pgp-substrate: | 0.232 |
| Human Intestinal Absorption (HIA): | 0.187 | 20% Bioavailability (F20%): | 0.012 |
| 30% Bioavailability (F30%): | 0.018 |
| Blood-Brain-Barrier Penetration (BBB): | 0.709 | Plasma Protein Binding (PPB): | 89.46% |
| Volume Distribution (VD): | 1.837 | Fu: | 10.85% |
| CYP1A2-inhibitor: | 0.009 | CYP1A2-substrate: | 0.109 |
| CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.451 |
| CYP2C9-inhibitor: | 0.018 | CYP2C9-substrate: | 0.064 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.112 |
| CYP3A4-inhibitor: | 0.738 | CYP3A4-substrate: | 0.605 |
| Clearance (CL): | 10.291 | Half-life (T1/2): | 0.049 |
| hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.405 |
| Drug-inuced Liver Injury (DILI): | 0.9 | AMES Toxicity: | 0.023 |
| Rat Oral Acute Toxicity: | 0.95 | Maximum Recommended Daily Dose: | 0.391 |
| Skin Sensitization: | 0.02 | Carcinogencity: | 0.12 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.375 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004310 | ![]() |
0.810 | D0W7RJ | ![]() |
0.255 | ||
| ENC003763 | ![]() |
0.809 | D0D4YZ | ![]() |
0.255 | ||
| ENC005175 | ![]() |
0.809 | D0V3ZA | ![]() |
0.254 | ||
| ENC005506 | ![]() |
0.809 | D0SP3D | ![]() |
0.254 | ||
| ENC001886 | ![]() |
0.786 | D0FX2Q | ![]() |
0.254 | ||
| ENC003335 | ![]() |
0.748 | D06CWH | ![]() |
0.253 | ||
| ENC005174 | ![]() |
0.748 | D09NNH | ![]() |
0.247 | ||
| ENC003619 | ![]() |
0.748 | D01TSI | ![]() |
0.247 | ||
| ENC003712 | ![]() |
0.683 | D0R1BD | ![]() |
0.246 | ||
| ENC005546 | ![]() |
0.661 | D04ITO | ![]() |
0.240 | ||