|
Name |
19,20-Epoxycytochalasin Q
|
| Molecular Formula | C30H37NO7 | |
| IUPAC Name* |
[(1R,2S,3S,5S,6R,8S,10E,12R,13S,15R,16S,17R,18S)-18-benzyl-6-hydroxy-6,8,15,16-tetramethyl-7,20-dioxo-4,14-dioxa-19-azapentacyclo[10.8.0.01,17.03,5.013,15]icos-10-en-2-yl] acetate
|
|
| SMILES |
C[C@H]1C/C=C/[C@H]2[C@H]3[C@](O3)([C@H]([C@@H]4[C@@]2([C@@H]([C@H]5[C@H](O5)[C@@](C1=O)(C)O)OC(=O)C)C(=O)N[C@H]4CC6=CC=CC=C6)C)C
|
|
| InChI |
InChI=1S/C30H37NO7/c1-15-10-9-13-19-24-29(5,38-24)16(2)21-20(14-18-11-7-6-8-12-18)31-27(34)30(19,21)26(36-17(3)32)22-25(37-22)28(4,35)23(15)33/h6-9,11-13,15-16,19-22,24-26,35H,10,14H2,1-5H3,(H,31,34)/b13-9+/t15-,16-,19-,20-,21-,22+,24-,25-,26+,28-,29+,30-/m0/s1
|
|
| InChIKey |
GSPOYKSHFNFUKI-QAWWVLLQSA-N
|
|
| Synonyms |
19,20-Epoxycytochalasin Q; MLS005941349; SMR004614064; J-012371; [(1R,2S,3S,5S,6R,8S,10E,12R,13S,15R,16S,17R,18S)-18-Benzyl-6-hydroxy-6,8,15,16-tetramethyl-7,20-dioxo-4,14-dioxa-19-azapentacyclo[10.8.0.01,17.03,5.013,15]icos-10-en-2-yl] acetate; 3H-Oxireno[f]oxireno[9,10]cycloundec[1,2-d]isoindole-5,9(4H,10H)-dione, 8-(acetyloxy)-6,6a,7a,8,11,11a,12,12a,13a,13b-decahydro-6-hydroxy-4,6,12,12a-tetramethyl-11-(phenylmethyl)-, (1E,4S,6R,6aS,7aS,8S,8aR,11S,11aR,12S,12aR,13aS,13bR)-
|
|
| CAS | NA | |
| PubChem CID | 6479878 | |
| ChEMBL ID | CHEMBL449278 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 523.6 | ALogp: | 2.4 |
| HBD: | 2 | HBA: | 7 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 118.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 38 | QED Weighted: | 0.355 |
| Caco-2 Permeability: | -4.889 | MDCK Permeability: | 0.00004140 |
| Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.217 |
| Human Intestinal Absorption (HIA): | 0.154 | 20% Bioavailability (F20%): | 0.037 |
| 30% Bioavailability (F30%): | 0.915 |
| Blood-Brain-Barrier Penetration (BBB): | 0.739 | Plasma Protein Binding (PPB): | 92.32% |
| Volume Distribution (VD): | 1.187 | Fu: | 6.11% |
| CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.085 |
| CYP2C19-inhibitor: | 0.049 | CYP2C19-substrate: | 0.449 |
| CYP2C9-inhibitor: | 0.052 | CYP2C9-substrate: | 0.026 |
| CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.147 |
| CYP3A4-inhibitor: | 0.821 | CYP3A4-substrate: | 0.382 |
| Clearance (CL): | 4.85 | Half-life (T1/2): | 0.587 |
| hERG Blockers: | 0.181 | Human Hepatotoxicity (H-HT): | 0.418 |
| Drug-inuced Liver Injury (DILI): | 0.936 | AMES Toxicity: | 0.025 |
| Rat Oral Acute Toxicity: | 0.416 | Maximum Recommended Daily Dose: | 0.852 |
| Skin Sensitization: | 0.202 | Carcinogencity: | 0.106 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.886 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004310 | ![]() |
0.835 | D0W7RJ | ![]() |
0.262 | ||
| ENC005546 | ![]() |
0.820 | D0R1BD | ![]() |
0.254 | ||
| ENC003712 | ![]() |
0.793 | D0V3ZA | ![]() |
0.253 | ||
| ENC005505 | ![]() |
0.786 | D00OAY | ![]() |
0.252 | ||
| ENC003763 | ![]() |
0.771 | D06CWH | ![]() |
0.252 | ||
| ENC005175 | ![]() |
0.771 | D0SP3D | ![]() |
0.246 | ||
| ENC005506 | ![]() |
0.771 | D09NNH | ![]() |
0.246 | ||
| ENC002202 | ![]() |
0.754 | D01TSI | ![]() |
0.246 | ||
| ENC003619 | ![]() |
0.713 | D0D4YZ | ![]() |
0.245 | ||
| ENC005174 | ![]() |
0.713 | D07HOF | ![]() |
0.244 | ||