|
Name |
Cytochalasin P1
|
| Molecular Formula | C30H39NO8 | |
| IUPAC Name* |
[(1R,2S,3S,5R,6R,8S,10E,12R,13S,14R,15S,16R,17S)-17-benzyl-6,13,14-trihydroxy-6,8,14,15-tetramethyl-7,19-dioxo-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadec-10-en-2-yl] acetate
|
|
| SMILES |
C[C@H]1C/C=C/[C@H]2[C@@H]([C@]([C@H]([C@@H]3[C@@]2([C@@H]([C@H]4[C@@H](O4)[C@@](C1=O)(C)O)OC(=O)C)C(=O)N[C@H]3CC5=CC=CC=C5)C)(C)O)O
|
|
| InChI |
InChI=1S/C30H39NO8/c1-15-10-9-13-19-24(34)28(4,36)16(2)21-20(14-18-11-7-6-8-12-18)31-27(35)30(19,21)26(38-17(3)32)22-25(39-22)29(5,37)23(15)33/h6-9,11-13,15-16,19-22,24-26,34,36-37H,10,14H2,1-5H3,(H,31,35)/b13-9+/t15-,16-,19-,20-,21-,22+,24-,25+,26+,28+,29-,30-/m0/s1
|
|
| InChIKey |
TUGYZQLJUCRIQE-FNYQVUCESA-N
|
|
| Synonyms |
Cytochalasin P1
|
|
| CAS | NA | |
| PubChem CID | 156581582 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 541.6 | ALogp: | 1.5 |
| HBD: | 4 | HBA: | 8 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 146.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 39 | QED Weighted: | 0.258 |
| Caco-2 Permeability: | -5.256 | MDCK Permeability: | 0.00007010 |
| Pgp-inhibitor: | 0.991 | Pgp-substrate: | 0.955 |
| Human Intestinal Absorption (HIA): | 0.821 | 20% Bioavailability (F20%): | 0.218 |
| 30% Bioavailability (F30%): | 0.972 |
| Blood-Brain-Barrier Penetration (BBB): | 0.187 | Plasma Protein Binding (PPB): | 90.07% |
| Volume Distribution (VD): | 0.928 | Fu: | 9.30% |
| CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.068 |
| CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.412 |
| CYP2C9-inhibitor: | 0.016 | CYP2C9-substrate: | 0.04 |
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.107 |
| CYP3A4-inhibitor: | 0.63 | CYP3A4-substrate: | 0.292 |
| Clearance (CL): | 2.324 | Half-life (T1/2): | 0.786 |
| hERG Blockers: | 0.125 | Human Hepatotoxicity (H-HT): | 0.694 |
| Drug-inuced Liver Injury (DILI): | 0.924 | AMES Toxicity: | 0.015 |
| Rat Oral Acute Toxicity: | 0.534 | Maximum Recommended Daily Dose: | 0.681 |
| Skin Sensitization: | 0.097 | Carcinogencity: | 0.034 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.227 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001886 | ![]() |
0.835 | D06CWH | ![]() |
0.265 | ||
| ENC005505 | ![]() |
0.810 | D0E9KA | ![]() |
0.262 | ||
| ENC005506 | ![]() |
0.795 | D0W7RJ | ![]() |
0.261 | ||
| ENC003763 | ![]() |
0.795 | D0D4YZ | ![]() |
0.259 | ||
| ENC005175 | ![]() |
0.795 | D0O5WP | ![]() |
0.252 | ||
| ENC005174 | ![]() |
0.736 | D0R1BD | ![]() |
0.252 | ||
| ENC003619 | ![]() |
0.736 | D0V3ZA | ![]() |
0.251 | ||
| ENC003335 | ![]() |
0.736 | D0SP3D | ![]() |
0.251 | ||
| ENC005546 | ![]() |
0.720 | D09NNH | ![]() |
0.245 | ||
| ENC003712 | ![]() |
0.672 | D01TSI | ![]() |
0.245 | ||